CAS 5219-65-8: 3-(Phenylthio)propanoic acid
Description:3-(Phenylthio)propanoic acid, with the CAS number 5219-65-8, is an organic compound characterized by the presence of a propanoic acid backbone substituted with a phenylthio group at the third carbon position. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the phenylthio group. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the phenylthio moiety can influence the compound's reactivity and interactions with other molecules, making it of interest in synthetic organic chemistry and potential applications in pharmaceuticals. Its structural features may also contribute to its biological activity, although specific biological properties would require further investigation. Overall, 3-(Phenylthio)propanoic acid serves as a valuable building block in organic synthesis and medicinal chemistry.
Formula:C9H10O2S
InChI:InChI=1S/C9H10O2S/c10-9(11)6-7-12-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11)
InChI key:InChIKey=IGPROYLOGZTOAM-UHFFFAOYSA-N
SMILES:O=C(O)CCSC=1C=CC=CC1
- Synonyms:
- 3-(Phenylsulfanyl)Propanoate
- 3-(Phenylsulfanyl)Propanoic Acid
- 3-(Phenylthio)propanoic acid
- 3-(Phenylthio)propionic acid
- 4-Phenyl-4-thiabutanoic acid
- NSC 14777
- NSC 8542
- Propanoic acid, 3-(phenylthio)-
- Propionic acid, 3-(phenylthio)-
- Thiophenoxypropionic acid
- See more synonyms
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 3-(PHENYLSULFANYL)PROPANOIC ACID REF: IN-DA00D8Y1CAS: 5219-65-8 | 95% | 172.00 €~582.00 € | Wed 23 Apr 25 |
 | 3-(Phenylthio)propanoic acid REF: 54-OR2272CAS: 5219-65-8 | 95% | 79.00 €~184.00 € | Thu 24 Apr 25 |
 | 3-(Phenylthio)propanoic acid REF: 10-F065695CAS: 5219-65-8 | 97.0% | To inquire | Mon 05 May 25 |
 | 3-(Phenylthio)propanoic acid REF: 3D-FP119423CAS: 5219-65-8 | Min. 95% | - - - | Discontinued product |
3-(PHENYLSULFANYL)PROPANOIC ACID
Ref: IN-DA00D8Y1
| 1g | 582.00 € | ||
| 100mg | 172.00 € | ||
| 250mg | 252.00 € |
Ref: 54-OR2272
| 1g | 184.00 € | ||
| 100mg | 79.00 € | ||
| 250mg | 96.00 € |
3-(Phenylthio)propanoic acid
Ref: 10-F065695
| 2.5g | To inquire |
3-(Phenylthio)propanoic acid
Ref: 3D-FP119423
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
