CAS 52193-85-8

R(+)-1-(2-naphthyl)ethanol

Description:

R(+)-1-(2-naphthyl)ethanol, with the CAS number 52193-85-8, is an organic compound characterized by its chiral structure, which includes a naphthyl group attached to a secondary alcohol. This compound is typically a colorless to pale yellow liquid and is known for its aromatic properties due to the presence of the naphthalene moiety. It exhibits optical activity, as indicated by its R configuration, making it significant in asymmetric synthesis and chiral resolution processes. The compound is soluble in organic solvents such as ethanol and ether but has limited solubility in water. R(+)-1-(2-naphthyl)ethanol is often utilized in the synthesis of various pharmaceuticals and fine chemicals, where its chiral nature can influence the biological activity of the resulting compounds. Additionally, it may serve as a ligand in coordination chemistry or as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.

Formula: C₁₂H₁₂O

InChI: InChI=1/C12H12O/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11/h2-9,13H,1H3/t9-/m1/s1

SMILES: C[C@H](c1ccc2ccccc2c1)O

Synonyms:

• (R)-(+)-alpha-methyl-2-naphthalene-methanol
• (1R)-1-naphthalen-2-ylethanol
• (R)-(+)-1-(2-Naphthyl)ethanol

(R)-1-(Naphthalen-2-yl)ethanol

CAS: 52193-85-8

Formula: C₁₂H₁₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 172.2231

Ref: IN-DA003C5S

(R)-(+)-1-(2-Naphthyl)ethanol

CAS: 52193-85-8

(R)-(+)-1-(2-Naphthyl)ethanol

Purity: 98%

Molecular weight: 172.23g/mol

Ref: 54-OR74788

(R)-(+)-1-(2-Naphthyl)ethanol

CAS: 52193-85-8

Formula: C₁₀H₇CH(CH₃)OH

Molecular weight: 172.22

Ref: 7W-GL9171

(R)-(+)-α-Methyl-2-Naphthalenemethanol

CAS: 52193-85-8

Formula: C₁₂H₁₂O

Purity: 95%

Molecular weight: 172.227

Ref: 10-F245761