CAS 521984-48-5: 6,7-dimethoxy-2-[(2E)-3-(1-methyl-2-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enoyl]-1,2,3,4-tetrahydroisoquinoline hydrochloride
Description:6,7-Dimethoxy-2-[(2E)-3-(1-methyl-2-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enoyl]-1,2,3,4-tetrahydroisoquinoline hydrochloride is a complex organic compound characterized by its unique structural features, including a tetrahydroisoquinoline core and multiple functional groups. The presence of methoxy groups at the 6 and 7 positions enhances its solubility and may influence its biological activity. The compound also contains a pyrrolo[2,3-b]pyridine moiety, which is known for its potential pharmacological properties. As a hydrochloride salt, it is likely to exhibit improved stability and solubility in aqueous environments, making it suitable for various applications, including medicinal chemistry. The compound's intricate structure suggests potential interactions with biological targets, which may be of interest in drug development. However, specific biological activities, toxicity, and pharmacokinetic properties would require further investigation through experimental studies. Overall, this compound represents a significant area of interest in the field of organic and medicinal chemistry.
Formula:C28H28ClN3O3
InChI:InChI=1/C28H27N3O3.ClH/c1-30-27(19-8-5-4-6-9-19)22(23-10-7-14-29-28(23)30)11-12-26(32)31-15-13-20-16-24(33-2)25(34-3)17-21(20)18-31;/h4-12,14,16-17H,13,15,18H2,1-3H3;1H/b12-11+;