CAS 522-11-2

(2S)-1-[(4,8-dimethoxyfuro[2,3-b]quinolin-7-yl)oxy]-3-methylbutane-2,3-diol

Description:

The chemical substance with the name "(2S)-1-[(4,8-dimethoxyfuro[2,3-b]quinolin-7-yl)oxy]-3-methylbutane-2,3-diol" and CAS number "522-11-2" is known as a complex organic compound featuring a furoquinoline structure. This compound typically exhibits characteristics such as being a chiral molecule due to the presence of a stereocenter, which can influence its biological activity and interactions. The presence of multiple functional groups, including methoxy and hydroxyl groups, suggests potential for hydrogen bonding and solubility in polar solvents. Its structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular weight, melting point, and solubility characteristics would be relevant for applications in drug formulation and development. Additionally, its potential biological activity could be explored in various therapeutic contexts, particularly in relation to its furoquinoline moiety, which is known for diverse biological effects. Overall, this compound represents a unique blend of structural complexity and potential utility in chemical and pharmaceutical research.

Formula: C₁₈H₂₁NO₆

InChI: InChI=1/C18H21NO6/c1-18(2,21)13(20)9-25-12-6-5-10-14(16(12)23-4)19-17-11(7-8-24-17)15(10)22-3/h5-8,13,20-21H,9H2,1-4H3/t13-/m0/s1

InChI key: InChIKey=FGANMDNHTVJAHL-CYBMUJFWSA-N

SMILES: CC(C)([C@H](COc1ccc2c(c1OC)nc1c(cco1)c2OC)O)O

EUDESMINE

CAS: 522-11-2

Formula: C₁₈H₂₁NO₆

Molecular weight: 347.3624

Ref: IN-DA00DGYS

Evoxine

CAS: 522-11-2

Evoxine blocks CO2's dampening effect on IL-6 and CCL2 in THP-1 macrophages.

Formula: C₁₈H₂₁NO₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 347.36

Ref: TM-T19854

Evoxine

CAS: 522-11-2

Formula: C₁₈H₂₁NO₆

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 347.367

Ref: BP-SBP01009

Haplophytin B

CAS: 522-11-2

Haplophytin B is a naturally occurring bioactive compound, which is isolated from plants of the genus Haplophyton. These plants are native to specific geographical regions and have been traditionally used in various ethnomedicinal systems. The compound is a type of phenanthroindolizidine alkaloid, characterized by its unique and complex molecular structure, allowing it to interact with biological systems effectively.

Formula: C₁₈H₂₁NO₆

Purity: Min. 95%

Molecular weight: 347.4 g/mol

Ref: 3D-AAA52211