CAS 522-19-0

Maculosidine

Description:

Maculosidine, with the CAS number 522-19-0, is a chemical compound classified as an alkaloid. It is primarily derived from certain plant species, particularly those in the family of Solanaceae. This compound is characterized by its complex molecular structure, which includes a bicyclic framework. Maculosidine exhibits various biological activities, including potential pharmacological effects, which have garnered interest in medicinal chemistry and pharmacognosy. Its solubility properties can vary depending on the solvent, and it may display moderate stability under standard conditions. The compound is often studied for its potential therapeutic applications, particularly in the context of neuropharmacology and as a potential agent in treating various ailments. However, detailed studies on its mechanism of action and full range of biological effects are still ongoing. As with many alkaloids, maculosidine may also exhibit toxicity at certain concentrations, necessitating careful handling and further research to fully understand its safety profile and potential uses in medicine.

Formula: C₁₄H₁₃NO₄

InChI: InChI=1S/C14H13NO4/c1-16-8-6-10-12(11(7-8)17-2)15-14-9(4-5-19-14)13(10)18-3/h4-7H,1-3H3

InChI key: InChIKey=SHAVHFJCSQWTFF-UHFFFAOYSA-N

SMILES: O(C)C=1C=2C(=C(OC)C=C(OC)C2)N=C3C1C=CO3

Synonyms:

• Furo[2,3-b]quinoline, 4,6,8-trimethoxy-
• Maculosidin
• 4,6,8-Trimethoxyfuro[2,3-b]quinoline
• Maculosidine
• 6,8-Dimethoxydictamnine

Maculosidin

CAS: 522-19-0

Maculosidine inhibits ATP synthesis and electron transport in spinach chloroplasts by targeting PS I.

Formula: C₁₄H₁₃NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 259.26

Ref: TM-TN6565

Maculosidin

CAS: 522-19-0

Maculosidin is a naturally occurring compound, classified as a bioactive alkaloid. It is originally derived from specific plant sources, notably within the Rubiaceae family. The mode of action of Maculosidin involves interaction with cellular signaling pathways, particularly those related to anti-inflammatory and anticancer activities. It functions by modulating key enzymes and receptors, thereby influencing various cellular processes crucial for maintaining cellular homeostasis and inhibiting proliferative signaling.

Formula: C₁₄H₁₃NO₄

Purity: Min. 95%

Molecular weight: 259.26 g/mol

Ref: 3D-AAA52219