CAS 522-53-2

Lobaric acid

Description:

Lobaric acid, with the CAS number 522-53-2, is a naturally occurring organic compound classified as a fatty acid. It is characterized by its long hydrocarbon chain, which contributes to its hydrophobic properties, making it insoluble in water but soluble in organic solvents. Lobaric acid is typically found in certain plant oils and has been studied for its potential biological activities, including antimicrobial and anti-inflammatory properties. Its molecular structure features a carboxylic acid functional group, which is responsible for its acidic nature. The compound is of interest in various fields, including biochemistry and pharmacology, due to its potential applications in the development of pharmaceuticals and nutraceuticals. Additionally, lobaric acid may play a role in metabolic processes and could be involved in the synthesis of other bioactive molecules. However, further research is necessary to fully understand its mechanisms of action and potential health benefits.

Formula: C₂₅H₂₈O₈

InChI: InChI=1S/C25H28O8/c1-4-6-8-9-15-21(24(28)29)18(27)13-20-23(15)32-19-12-14(31-3)11-16(17(26)10-7-5-2)22(19)25(30)33-20/h11-13,27H,4-10H2,1-3H3,(H,28,29)

InChI key: InChIKey=JHEWMLHQNRHTQX-UHFFFAOYSA-N

SMILES: C(CCCC)C1=C2C(OC(=O)C=3C(O2)=CC(OC)=CC3C(CCCC)=O)=CC(O)=C1C(O)=O

Synonyms:

• Lobaric acid
• 11H-dibenzo[b,e][1,4]dioxepin-7-carboxylic acid, 8-hydroxy-3-methoxy-11-oxo-1-(1-oxopentyl)-6-pentyl-
• 11H-Dibenzo[b,e][1,4]dioxepin-7-carboxylic acid, 8-hydroxy-3-methoxy-11-oxo-1-(1-oxopentyl)-6-pentyl-
• Stereocaulic acid
• 11H-Dibenzo[b,e][1,4]dioxepin-7-carboxylic acid, 8-hydroxy-3-methoxy-11-oxo-6-pentyl-1-valeryl-
• 8-Hydroxy-3-methoxy-11-oxo-1-(1-oxopentyl)-6-pentyl-11H-dibenzo[b,e][1,4]dioxepin-7-carboxylic acid

Lobaric acid(aS)

CAS: 522-53-2

Lobaric acid is a bioactive compound, specifically a depsidone, which is a secondary metabolite produced by certain lichen species. Its chemical structure contributes to its function as a potential antiviral agent. The source of lobaric acid is primarily within various lichen species that grow in diverse ecological niches. These organisms synthesize lobaric acid as part of their chemical defense mechanisms, allowing them to thrive in challenging environments.

Formula: C₂₅H₂₈O₈

Purity: Min. 95%

Molecular weight: 456.5 g/mol

Ref: 3D-AAA52253

Lobaric acid

CAS: 522-53-2

Lobaric acid, from Stereocaulon lichen, has antioxidant and anticancer properties, inhibits PTP1B and 12(S)-LOX, and reduces TMV lesions in plants.

Formula: C₂₅H₂₈O₈

Color and Shape: Solid

Molecular weight: 456.48

Ref: TM-T71811