CAS 52205-85-3
:2,3-dihydro-1H-indene-5-sulfonyl chloride
Description:
2,3-Dihydro-1H-indene-5-sulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions, particularly in the formation of sulfonamides and other derivatives. This compound features a bicyclic structure, which contributes to its unique chemical properties, including its ability to participate in electrophilic substitution reactions. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the sulfonyl chloride group makes it a useful reagent in organic synthesis, particularly in the preparation of sulfonyl derivatives. Additionally, it is important to handle this compound with care due to its potential reactivity and the release of hydrochloric acid upon hydrolysis. As with many sulfonyl chlorides, it may also exhibit moderate to high toxicity, necessitating appropriate safety precautions during handling and use in laboratory settings.
Formula:C9H9ClO2S
InChI:InChI=1/C9H9ClO2S/c10-13(11,12)9-5-4-7-2-1-3-8(7)6-9/h4-6H,1-3H2
SMILES:C1Cc2ccc(cc2C1)S(=O)(=O)Cl
Synonyms:- 1H-Indene-5-sulfonyl chloride, 2,3-dihydro-
- Indane-5-sulfonyl chloride
- Indane-5-sulfonylchloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Indane-5-sulfonyl chloride, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H9ClO2SPurity:97%Color and Shape:White, Crystalline powder or powderMolecular weight:216.68Indane-5-sulfonyl chloride
CAS:Formula:C9H9ClO2SPurity:97%Color and Shape:SolidMolecular weight:216.6846Indane-5-sulphonyl chloride
CAS:Indane-5-sulphonyl chlorideFormula:C9H9ClO2SPurity:techColor and Shape: faint orange crystalline solidMolecular weight:216.68g/molIndan-5-sulfonyl chloride
CAS:Formula:C9H9ClO2SPurity:97%Color and Shape:SolidMolecular weight:216.68



