CAS 52208-11-4

2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)ethyl carbamimidothioate

Description:

2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)ethyl carbamimidothioate is a chemical compound characterized by its unique structure, which includes an isoindole moiety and a carbamimidothioate functional group. This compound typically exhibits properties associated with both the isoindole and thioamide functionalities, such as potential biological activity and reactivity. The presence of the dioxo group suggests that it may participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Its carbamimidothioate component may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound is likely to be soluble in polar solvents, and its stability can be influenced by environmental factors such as pH and temperature. Additionally, due to its complex structure, it may exhibit interesting spectroscopic properties, making it suitable for characterization using techniques like NMR and mass spectrometry. Overall, this compound represents a class of molecules that could have applications in drug development or as intermediates in organic synthesis.

Formula: C₁₁H₁₁N₃O₂S

InChI: InChI=1/C11H11N3O2S/c12-11(13)17-6-5-14-9(15)7-3-1-2-4-8(7)10(14)16/h1-4H,5-6H2,(H3,12,13)

SMILES: c1ccc2c(c1)C(=O)N(CCSC(=N)N)C2=O

{[2-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)ethyl]sulfanyl}methanimidamide hydrobromide

CAS: 52208-11-4

Formula: C₁₁H₁₂BrN₃O₂S

Purity: 95.0%

Molecular weight: 330.2

Ref: 10-F525831