CAS 52208-50-1
:2,6-Dichloro-3-fluoropyridine
Description:
2,6-Dichloro-3-fluoropyridine is a heterocyclic aromatic compound characterized by a pyridine ring substituted with two chlorine atoms and one fluorine atom. Its molecular formula is C5H3Cl2FN, and it features a nitrogen atom within the six-membered ring, contributing to its basicity and reactivity. The presence of the halogen substituents significantly influences its chemical properties, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. This compound typically exhibits a colorless to pale yellow appearance and has a moderate boiling point, indicating volatility. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. 2,6-Dichloro-3-fluoropyridine is known for its potential applications in medicinal chemistry, particularly in the development of compounds with biological activity. However, handling this substance requires caution due to its potential toxicity and environmental impact, necessitating appropriate safety measures in laboratory and industrial settings.
Formula:C5H2Cl2FN
InChI:InChI=1/C5H2Cl2FN/c6-4-2-1-3(8)5(7)9-4/h1-2H
SMILES:c1cc(Cl)nc(c1F)Cl
Synonyms:- Pyridine, 2,6-Dichloro-3-Fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pyridine, 2,6-dichloro-3-fluoro-
CAS:Formula:C5H2Cl2FNPurity:98%Color and Shape:SolidMolecular weight:165.98052,6-Dichloro-3-fluoropyridine
CAS:2,6-Dichloro-3-fluoropyridineFormula:C5H2Cl2FNPurity:95%Color and Shape: white to off-white solidMolecular weight:165.98g/mol2,6-Dichloro-3-fluoropyridine
CAS:<p>2,6-Dichloro-3-fluoropyridine is a synthetic organic chemical that can be used as a diazo compound in the synthesis of heterocycles. It is used in industrial applications for the production of nitrobenzene, an intermediate for the synthesis of pharmaceuticals. The reaction time and yield are high, and the selectivity is good. 2,6-Dichloro-3-fluoropyridine can be synthesized by reacting sodium nitrite with piperidine and acidifying with hydrochloric acid. This chemical is mainly used as an industrial intermediate to produce nitrobenzene.</p>Formula:C5H2Cl2FNPurity:(%) Min. 95%Color and Shape:PowderMolecular weight:165.98 g/mol2,6-Dichloro-3-fluoropyridine
CAS:Formula:C5H2Cl2FNPurity:95%Color and Shape:SolidMolecular weight:165.98



