CAS 52208-61-4

(1,3-dioxo-3,4-dihydroisoquinolin-2(1H)-yl)acetate

Description:

(1,3-Dioxo-3,4-dihydroisoquinolin-2(1H)-yl)acetate, with the CAS number 52208-61-4, is a chemical compound that features a complex structure characteristic of isoquinoline derivatives. This substance typically exhibits a bicyclic framework, which includes a dioxo functional group contributing to its reactivity and potential biological activity. The presence of the acetate moiety suggests that it may participate in esterification reactions and could serve as a prodrug or a precursor in synthetic pathways. Compounds of this nature are often studied for their pharmacological properties, including potential anti-inflammatory, analgesic, or antimicrobial effects. Additionally, the structural features may influence solubility, stability, and interaction with biological targets. As with many organic compounds, its behavior in various environments, such as solvents or biological systems, can be influenced by factors like pH and temperature. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.

Formula: C₁₁H₈NO₄

InChI: InChI=1/C11H9NO4/c13-9-5-7-3-1-2-4-8(7)11(16)12(9)6-10(14)15/h1-4H,5-6H2,(H,14,15)/p-1

SMILES: c1ccc2c(c1)CC(=O)N(CC(=O)[O-])C2=O

2-(1,3-Dioxo-3,4-dihydroisoquinolin-2(1H)-yl)acetic Acid

Controlled Product

CAS: 52208-61-4

Stability Hygroscopic
Applications 2-(1,3-Dioxo-3,4-dihydroisoquinolin-2(1H)-yl)acetic Acid (cas# 52208-61-4) is a useful research chemical.

Formula: C₁₁H₉NO₄

Color and Shape: Neat

Molecular weight: 219.19

Ref: TR-D496273

2-(1,3-Dioxo-1,2,3,4-tetrahydroisoquinolin-2-yl)acetic acid

CAS: 52208-61-4

Versatile small molecule scaffold

Formula: C₁₁H₉NO₄

Purity: Min. 95%

Molecular weight: 219.19 g/mol

Ref: 3D-CCA20861