CAS 5221-44-3
:N-(4-Pyridyl)benzamide
Description:
N-(4-Pyridyl)benzamide, with the CAS number 5221-44-3, is an organic compound characterized by the presence of a benzamide functional group linked to a pyridine ring. This compound features a pyridine nitrogen atom that is part of a four-carbon ring, which contributes to its aromatic properties. The benzamide portion consists of a benzene ring attached to a carbonyl group (C=O) and an amine (NH2) group, making it a derivative of benzoic acid. N-(4-Pyridyl)benzamide is typically a white to off-white solid and is soluble in polar organic solvents. Its molecular structure allows for potential interactions through hydrogen bonding and π-π stacking, which can influence its reactivity and biological activity. This compound is of interest in various fields, including medicinal chemistry, due to its potential applications in drug development and as a ligand in coordination chemistry. Its properties can be further explored through techniques such as spectroscopy and crystallography to understand its behavior in different environments.
Formula:C12H10N2O
InChI:InChI=1S/C12H10N2O/c15-12(10-4-2-1-3-5-10)14-11-6-8-13-9-7-11/h1-9H,(H,13,14,15)
InChI key:InChIKey=PNWVOLKZHJEWQU-UHFFFAOYSA-N
SMILES:C(NC=1C=CN=CC1)(=O)C2=CC=CC=C2
Synonyms:- 4-Benzamidopyridine
- 4-Benzoylaminopyridine
- Benzamide, N-4-pyridinyl-
- Benzamide, N-4-pyridinyl- (9CI)
- Brn 0142075
- N-(4-Pyridinyl)benzamide
- N-(4-Pyridyl)benzamide
- N-(pyridin-4-yl)benzamide
- N-4-Pyridinylbenzamide
- N-4-Pyridylbenzamide
- N-Benzoyl-4-pyridinamine
- Phenyl 4-pyridylcarbamate
- Pyridine, 4-benzamido-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-(Pyridin-4-yl)benzamide
CAS:N-(Pyridin-4-yl)benzamideFormula:C12H10N2OPurity:≥95%Color and Shape: off-white crystalline powderMolecular weight:198.22g/molN-(Pyridin-4-yl)benzamide
CAS:N-(Pyridin-4-yl)benzamide is a control agent that is used as a pest control. It inhibits the enzyme nitric oxide synthase and prevents the production of nitric oxide, which has been implicated in the uncontrolled proliferation of certain cells. N-(Pyridin-4-yl)benzamide also has anti-cancer properties, inhibiting cancer cell growth by regulating DNA replication and protein synthesis. This drug is effective against colon cancer cells but not against breast cancer cells.
The supramolecular chemistry of this molecule was studied using diffraction techniques on calf thymus DNA and bacterial DNA gyrase. The transfer of energy from one molecule to another was observed using absorption spectroscopy on mouse brain tissue.Formula:C12H10N2OPurity:Min. 95%Molecular weight:198.22 g/mol

