CAS 52210-90-9
:1-pyridin-4-ylimidazolidin-2-one
Description:
1-Pyridin-4-ylimidazolidin-2-one, with the CAS number 52210-90-9, is a heterocyclic organic compound characterized by its imidazolidinone structure fused with a pyridine ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, which is indicative of its polar functional groups. The presence of both the imidazolidinone and pyridine moieties contributes to its potential biological activity, making it of interest in medicinal chemistry. It may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects would depend on the context of its use and the presence of substituents. The compound's molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its reactivity and interactions with biological targets. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it a versatile building block in organic synthesis.
Formula:C8H9N3O
InChI:InChI=1/C8H9N3O/c12-8-10-5-6-11(8)7-1-3-9-4-2-7/h1-4H,5-6H2,(H,10,12)
SMILES:c1cnccc1N1CCN=C1O
Synonyms:- 1-(Pyridin-4-yl)imidazolidin-2-one
- 2-Imidazolidinone, 1-(4-pyridinyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(Pyridin-4-yl)imidazolidin-2-one
CAS:1-(Pyridin-4-yl)imidazolidin-2-one
Molecular weight:163.17656g/mol1-Pyridin-4-yl-imidazolidin-2-one
CAS:1-Pyridin-4-yl-imidazolidin-2-one is a potent inhibitor of the growth hormone receptor, which in turn prevents the activation of the insulin receptor and glycogenolysis. It has been shown to attenuate cachexia in mice by reducing their weight loss. 1Pyridin-4-yl-imidazolidin-2-one also exerts an antihypertensive effect on congestive heart failure by inhibiting alpha 2 adrenergic receptors. This drug has been shown to have a stimulatory effect on premarin production and to be an effective insecticide against aphids, mites, and caterpillars.
Formula:C8H9N3OPurity:Min. 95%Molecular weight:163.18 g/molRef: 3D-CCA21090
Discontinued product



