
CAS 52212-94-9
:(4R,5S,6S,7S,9R,11E,13E,16R)-7-Ethyl-4,6-dihydroxy-5-methoxy-9,16-dimethyloxacyclohexadeca-11,13-diene-2,10-dione
Description:
The chemical substance with the name "(4R,5S,6S,7S,9R,11E,13E,16R)-7-Ethyl-4,6-dihydroxy-5-methoxy-9,16-dimethyloxacyclohexadeca-11,13-diene-2,10-dione" and CAS number "52212-94-9" is a complex organic compound characterized by its unique stereochemistry and functional groups. It features multiple chiral centers, which contribute to its specific three-dimensional arrangement and potentially influence its biological activity. The presence of hydroxyl (-OH) and methoxy (-OCH3) groups indicates that it may exhibit polar characteristics, affecting its solubility and reactivity. The diene structure suggests the potential for conjugation, which can enhance stability and influence electronic properties. Additionally, the oxacyclohexadecane framework indicates a cyclic structure that may play a role in its conformational stability. This compound may be of interest in fields such as medicinal chemistry or natural product synthesis, where its structural features could be linked to specific biological functions or therapeutic applications. Further studies would be necessary to elucidate its full chemical behavior and potential uses.
Formula:C20H32O6
InChI:InChI=1S/C20H32O6/c1-5-15-11-13(2)16(21)10-8-6-7-9-14(3)26-18(23)12-17(22)20(25-4)19(15)24/h6-8,10,13-15,17,19-20,22,24H,5,9,11-12H2,1-4H3/b7-6+,10-8+/t13-,14-,15+,17-,19+,20+/m1/s1
InChI key:InChIKey=VWVDRJWACDDRKD-SECFAUQFSA-N
SMILES:O(C)[C@@H]1[C@@H](O)[C@@H](CC)C[C@@H](C)C(=O)/C=C/C=C/C[C@@H](C)OC(=O)C[C@H]1O
Synonyms:- Leuconolide, 18-deoxo-9-deoxy-9-oxo-
- Oxacyclohexadeca-11,13-diene-2,10-dione, 7-ethyl-4,6-dihydroxy-5-methoxy-9,16-dimethyl-, (4R,5S,6S,7S,9R,11E,13E,16R)-
- (4R,5S,6S,7S,9R,11E,13E,16R)-7-Ethyl-4,6-dihydroxy-5-methoxy-9,16-dimethyloxacyclohexadeca-11,13-diene-2,10-dione
- Platenolide I
- Oxacyclohexadecane, leuconolide deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Platenolide I
CAS:Platenolide I is a macrolactone extracted from Streptomyces platensis.Formula:C20H32O6Color and Shape:SolidMolecular weight:368.46
