CAS 52218-19-6
:3-(4-Hydroxy-3-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)-2-propen-1-one
Description:
The chemical substance known as 3-(4-Hydroxy-3-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)-2-propen-1-one, with the CAS number 52218-19-6, is a type of chalcone, which is a class of compounds characterized by a specific structure featuring a phenyl group connected to an α,β-unsaturated carbonyl system. This compound exhibits notable antioxidant and anti-inflammatory properties, attributed to its phenolic hydroxyl groups, which can donate hydrogen atoms and scavenge free radicals. The presence of methoxy and hydroxyl substituents enhances its biological activity and solubility in polar solvents. Additionally, chalcones are known for their potential in various pharmacological applications, including anti-cancer and anti-microbial activities. The compound's structural features suggest it may participate in various chemical reactions, such as Michael addition or condensation reactions, making it of interest in synthetic organic chemistry. Overall, this substance represents a fascinating area of study due to its diverse biological activities and potential therapeutic applications.
Formula:C16H14O6
InChI:InChI=1S/C16H14O6/c1-22-15-6-9(2-4-11(15)18)3-5-12(19)16-13(20)7-10(17)8-14(16)21/h2-8,17-18,20-21H,1H3
InChI key:InChIKey=WQWVIIRCVOZVPN-UHFFFAOYSA-N
SMILES:C(C=CC1=CC(OC)=C(O)C=C1)(=O)C2=C(O)C=C(O)C=C2O
Synonyms:- 2-Propen-1-one, 3-(4-hydroxy-3-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)-
- 2′,4,4′,6′-Tetrahydroxy-3-methoxychalcone
- 3-(4-Hydroxy-3-Methoxyphenyl)-1-(2,4,6-Trihydroxyphenyl)Prop-2-En-1-One
- 3-(4-Hydroxy-3-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)-2-propen-1-one
- 3-Methoxy-2′,4′,6′,4-tetrahydroxychalcone
- Chalcone, 2′,4,4′,6′-tetrahydroxy-3-methoxy-
- 2',4,4',6'-Tetrahydroxy-3-methoxychalcone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Homoeriodictyol chalcone
CAS:Homoeriodictyol chalcone analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C16H14O6Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:302.28Homoeriodictyol chalcone
CAS:Homoeriodictyol chalcone,2',4,4',6'-tetrahydroxy-3-methoxychalcone is a natural chalcone glucoside used in biochemical experiments and organic synthesis.Formula:C16H14O6Purity:99.44%Color and Shape:SoildMolecular weight:302.283-Methoxy-2',4',6',4-tetrahydroxychalcone (>80%)
CAS:Controlled ProductApplications 3-Methoxy-2',4',6',4-tetrahydroxychalcone piperidine complex (cas# 52218-19-6) is a useful research chemical.
Formula:C16H14O6Purity:>80%Color and Shape:NeatMolecular weight:302.282',4',6',4-Tetrahydroxy-3-methoxydihydrochalcone
CAS:2',4',6',4-Tetrahydroxy-3-methoxydihydrochalcone is a dihydrochalcone compound, which is a type of flavonoid derivative. This compound is primarily sourced from plant materials, notably certain fruits and vegetables, where it plays a role in the plant's defense mechanisms. The mode of action for this compound involves its potent antioxidant capabilities. It functions by scavenging free radicals and mitigating oxidative stress within biological systems, thus providing a protective effect on cellular structures.
Formula:C16H14O6Purity:Min. 95%Molecular weight:302.28 g/mol





