CAS 52237-19-1
:4-amino-3-(4-fluorophenyl)butanoic acid
Description:
4-Amino-3-(4-fluorophenyl)butanoic acid, with the CAS number 52237-19-1, is an organic compound characterized by its amino acid structure, which includes an amino group (-NH2), a carboxylic acid group (-COOH), and a butanoic acid backbone. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on a phenyl ring at the para position, which can influence the compound's biological activity and chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents due to its ionic and polar functional groups. It may exhibit properties such as being a potential intermediate in pharmaceutical synthesis or a building block in medicinal chemistry. The presence of both amino and carboxylic acid functional groups allows it to participate in various chemical reactions, including peptide bond formation. Its specific applications and reactivity can vary based on the context of use, particularly in drug development or biochemical research.
Formula:C10H12FNO2
InChI:InChI=1/C10H12FNO2/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8H,5-6,12H2,(H,13,14)
SMILES:c1cc(ccc1C(CC(=O)O)CN)F
Synonyms:- Benzenepropanoic Acid, Beta-(Aminomethyl)-4-Fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cgp 11130
CAS:Cgp 11130 is a bio-active chemical.Formula:C10H12FNO2Color and Shape:SolidMolecular weight:197.21
