
CAS 5224-54-4
:Mammea A/BA
Description:
Mammea A/BA, with the CAS number 5224-54-4, is a chemical compound derived from the Mammea americana tree, which is native to tropical regions. This substance is primarily known for its potential medicinal properties, including antimicrobial and anti-inflammatory effects. Mammea A/BA belongs to the class of compounds known as coumarins, which are characterized by their benzopyrone structure. These compounds often exhibit a range of biological activities, making them of interest in pharmacology and natural product chemistry. Mammea A/BA is typically found in the form of a yellowish crystalline solid and is soluble in organic solvents. Its applications extend to traditional medicine, where it has been used for various ailments, although further research is necessary to fully understand its efficacy and safety. As with many natural compounds, the extraction and purification processes can influence its properties and potential uses in therapeutic contexts.
Formula:C25H26O5
InChI:InChI=1S/C25H26O5/c1-14(2)10-11-17-23(28)21-18(16-8-6-5-7-9-16)13-20(27)30-25(21)22(24(17)29)19(26)12-15(3)4/h5-10,13,15,28-29H,11-12H2,1-4H3
InChI key:InChIKey=SBHOAZQBEGVQLJ-UHFFFAOYSA-N
SMILES:OC1=C2C(=C(C(CC(C)C)=O)C(O)=C1CC=C(C)C)OC(=O)C=C2C3=CC=CC=C3
Synonyms:- 5,7-Dihydroxy-6-(3-methyl-2-buten-1-yl)-8-(3-methyl-1-oxobutyl)-4-phenyl-2H-1-benzopyran-2-one
- 2H-1-Benzopyran-2-one, 5,7-dihydroxy-6-(3-methyl-2-butenyl)-8-(3-methyl-1-oxobutyl)-4-phenyl-
- 2H-1-Benzopyran-2-one, 5,7-dihydroxy-6-(3-methyl-2-buten-1-yl)-8-(3-methyl-1-oxobutyl)-4-phenyl-
- Mammea A/BA
- Coumarin, 5,7-dihydroxy-8-isovaleryl-6-(3-methyl-2-butenyl)-4-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Mammea A/BA
CAS:<p>Mammea A/BA combats T. cruzi by causing mitochondrial damage, ROS, DNA fragmentation, and vacuolization, leading to cell death. Useful for Chagas research.</p>Formula:C25H26O5Color and Shape:SolidMolecular weight:406.47
