CymitQuimica logo

CAS 52245-00-8

:

[2-(2,2-dimethylpropanoyloxy)-4-[2-(methylamino)acetyl]phenyl] 2,2-dimethylpropanoate

Description:
The chemical substance known as [2-(2,2-dimethylpropanoyloxy)-4-[2-(methylamino)acetyl]phenyl] 2,2-dimethylpropanoate, with the CAS number 52245-00-8, is a complex organic compound characterized by its specific functional groups and structural features. It contains an aromatic ring substituted with various functional moieties, including an ester group and an amide group, which contribute to its chemical reactivity and potential biological activity. The presence of the dimethylpropanoyloxy group suggests that it may exhibit lipophilic properties, enhancing its solubility in organic solvents. Additionally, the methylaminoacetyl substituent indicates potential interactions with biological systems, possibly influencing pharmacological effects. This compound may be of interest in medicinal chemistry and drug development due to its structural complexity and the potential for diverse interactions within biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the steric and electronic effects of the substituents present.
Formula:C19H27NO5
InChI:InChI=1/C19H27NO5/c1-18(2,3)16(22)24-14-9-8-12(13(21)11-20-7)10-15(14)25-17(23)19(4,5)6/h8-10,20H,11H2,1-7H3
SMILES:CC(C)(C)C(=O)Oc1ccc(cc1OC(=O)C(C)(C)C)C(=O)CNC
Synonyms:
  • 4-(N-Methylglycyl)-1,2-phenylene bis(2,2-dimethylpropanoate)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.