CAS 52248-54-1: Δ7-Stigmasterol

Description:Δ7-Stigmasterol is a phytosterol, a type of plant-derived sterol that is structurally similar to cholesterol. It is characterized by a double bond at the Δ7 position in its steroid nucleus, which distinguishes it from other sterols. This compound is typically found in various plant sources, including legumes, nuts, and certain vegetable oils. Δ7-Stigmasterol plays a role in plant cell membrane structure and function, contributing to membrane fluidity and stability. In terms of its biological properties, it has been studied for potential health benefits, including cholesterol-lowering effects and anti-inflammatory properties. Additionally, Δ7-Stigmasterol may exhibit antioxidant activity, which can be beneficial in reducing oxidative stress in biological systems. Its solubility characteristics are similar to other sterols, being more soluble in organic solvents than in water. Overall, Δ7-Stigmasterol is of interest in both nutritional science and pharmacology due to its potential health-promoting effects and its role in plant biology.

Formula:C₂₉H₄₆O

InChI:InChI=1S/C29H46O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-11,19-21,23,25-27,30H,7,12-18H2,1-6H3/b9-8+/t20-,21-,23+,25-,26+,27+,28+,29-/m1/s1

InChI key:InChIKey=OQMZNAMGEHIHNN-CIFIHVIMSA-N

SMILES:OC1CC2=CC=C3C(CCC4(C)C3CCC4C(C=CC(CC)C(C)C)C)C2(C)CC1