CAS 52249-32-8
:5-methyl-5H-dibenzo[b,f]azepine
Description:
5-Methyl-5H-dibenzo[b,f]azepine is a chemical compound characterized by its unique bicyclic structure, which consists of a dibenzoazepine framework. This compound features a nitrogen atom incorporated into a seven-membered ring, contributing to its heterocyclic nature. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents. The presence of the methyl group at the 5-position influences its chemical reactivity and physical properties, such as melting point and boiling point. 5-Methyl-5H-dibenzo[b,f]azepine is of interest in medicinal chemistry, particularly for its potential pharmacological activities, including its role as an antidepressant and anxiolytic agent. Its structure allows for interactions with various biological targets, making it a subject of research in drug development. Additionally, the compound's stability and reactivity can be influenced by substituents and environmental conditions, which are important considerations in synthetic applications and biological studies. Overall, 5-methyl-5H-dibenzo[b,f]azepine represents a significant compound in the field of organic and medicinal chemistry.
Formula:C15H13N
InChI:InChI=1/C15H13N/c1-16-14-8-4-2-6-12(14)10-11-13-7-3-5-9-15(13)16/h2-11H,1H3
SMILES:CN1c2ccccc2C=Cc2ccccc12
Synonyms:- 5H-Dibenz(b,f)azepine, 5-methyl-
- 5-Methyl-5H-dibenz(b,f)azepine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.



