
CAS 52259-64-0
:Benzo[c]phenanthridinium, 2-hydroxy-3,8,9-trimethoxy-5-methyl-, chloride (1:1)
Description:
Benzo[c]phenanthridinium, 2-hydroxy-3,8,9-trimethoxy-5-methyl-, chloride (1:1), with CAS number 52259-64-0, is a synthetic organic compound belonging to the class of phenanthridine derivatives. This substance features a complex polycyclic structure characterized by a benzo[c]phenanthridinium core, which is a nitrogen-containing heterocyclic compound. The presence of multiple methoxy groups (–OCH3) at positions 3, 8, and 9, along with a hydroxyl group (–OH) at position 2 and a methyl group (–CH3) at position 5, contributes to its unique chemical properties and potential biological activity. The chloride ion indicates that it exists as a salt, which can influence its solubility and reactivity. Such compounds are often studied for their pharmacological properties, including potential antimicrobial and anticancer activities. The specific arrangement of functional groups can significantly affect the compound's interaction with biological systems, making it of interest in medicinal chemistry and drug development.
Formula:C21H20NO4·Cl
InChI:InChI=1S/C21H19NO4.ClH/c1-22-11-13-8-19(25-3)20(26-4)9-15(13)14-6-5-12-7-17(23)18(24-2)10-16(12)21(14)22;/h5-11H,1-4H3;1H
InChI key:InChIKey=VVEPUJCLNRDIEQ-UHFFFAOYSA-N
SMILES:C[N+]=1C2=C(C=3C(C1)=CC(OC)=C(OC)C3)C=CC=4C2=CC(OC)=C(O)C4.[Cl-]
Synonyms:- NSC 157995
- Benzo[c]phenanthridinium, 2-hydroxy-3,8,9-trimethoxy-5-methyl-, chloride (1:1)
- Fagaronine chloride
- Benzo[c]phenanthridinium, 2-hydroxy-3,8,9-trimethoxy-5-methyl-, chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Fagaronine chloride
CAS:Fagaronine chloride is a potent inhibitor of Topoisomerases I.Formula:C21H20ClNO4Color and Shape:SolidMolecular weight:385.84
