CAS 5226-51-7
:2,2-dimethyl-1,4-dihydro-3,1-benzoxazine
Description:
2,2-Dimethyl-1,4-dihydro-3,1-benzoxazine, with the CAS number 5226-51-7, is an organic compound characterized by its bicyclic structure that includes a benzene ring fused to a heterocyclic oxazine moiety. This compound typically exhibits a pale yellow to colorless appearance and is known for its stability under standard conditions. It possesses a molecular formula that reflects its complex structure, incorporating both carbon and nitrogen atoms. The presence of the dimethyl groups contributes to its steric hindrance, which can influence its reactivity and interactions with other chemical species. 2,2-Dimethyl-1,4-dihydro-3,1-benzoxazine is often studied for its potential applications in materials science, particularly in the development of polymers and as a precursor in organic synthesis. Its unique properties may also lend it utility in various chemical reactions, including those involving nucleophilic substitutions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C10H13NO
InChI:InChI=1/C10H13NO/c1-10(2)11-9-6-4-3-5-8(9)7-12-10/h3-6,11H,7H2,1-2H3
SMILES:CC1(C)Nc2ccccc2CO1
Synonyms:- 2,2-Dimethyl-1,4-dihydro-2H-3,1-benzoxazine
- 2H-3,1-benzoxazine, 1,4-dihydro-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,2-Dimethyl-1,4-dihydro-2H-benzo[d][1,3]oxazine
CAS:<p>2,2-Dimethyl-1,4-dihydro-2H-benzo[d][1,3]oxazine</p>Molecular weight:163.22g/mol

