CAS 52260-48-7
:methyl 4,6-O-benzylidene-3-O-methylhexopyranoside
Description:
Methyl 4,6-O-benzylidene-3-O-methylhexopyranoside is a glycoside compound characterized by its structural features that include a hexopyranose sugar moiety modified with a benzylidene group at the 4 and 6 positions and a methoxy group at the 3 position. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as methanol and ethanol, while being less soluble in water due to its hydrophobic benzylidene substituents. The presence of the methoxy group enhances its reactivity and potential applications in organic synthesis. Methyl 4,6-O-benzylidene-3-O-methylhexopyranoside may also display interesting biological activities, making it a subject of interest in medicinal chemistry and carbohydrate chemistry. Its unique structure allows for various chemical modifications, which can lead to the development of derivatives with enhanced properties. As with many glycosides, it may undergo hydrolysis under acidic or enzymatic conditions, releasing the sugar and the aglycone components.
Formula:C15H20O6
InChI:InChI=1/C15H20O6/c1-17-13-11(16)15(18-2)20-10-8-19-14(21-12(10)13)9-6-4-3-5-7-9/h3-7,10-16H,8H2,1-2H3
SMILES:COC1C(C(OC)OC2COC(c3ccccc3)OC12)O
Synonyms:- 6,8-Dimethoxy-2-Phenylhexahydropyrano[3,2-D][1,3]Dioxin-7-Ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4,6-O-Benzylidene-1,3-di-O-methyl-a-D-mannopyranoside
CAS:<p>4,6-O-Benzylidene-1,3-di-O-methyl-a-D-mannopyranoside is an antiviral agent that has been shown to inhibit the replication of a number of RNA and DNA viruses. The compound binds to the active site of the virus and reacts with nucleophilic groups on the sugar ring. This reaction leads to a nitro group being introduced into the sugar ring of the virus. This nitro group is then alkylated by nucleophilic groups in proteins and other cellular components. 4,6-O-Benzylidene-1,3-di-O-methyla D mannopyranoside has been shown to inhibit hepatitis A virus (HAV) infection in vitro and in vivo.</p>Formula:C15H20O6Purity:Min. 95%Molecular weight:296.32 g/mol

