
CAS 522600-31-3
:(9R)-10,11-Dihydro-6′-methoxycinchonan-9-amine
Description:
(9R)-10,11-Dihydro-6′-methoxycinchonan-9-amine is a chemical compound that belongs to the class of cinchona alkaloids, which are derived from the bark of the cinchona tree. This compound features a complex bicyclic structure, characterized by a quinoline-like framework, which contributes to its biological activity. The presence of a methoxy group at the 6' position and an amine group at the 9 position enhances its pharmacological properties. It is known for its potential use in medicinal chemistry, particularly in the development of drugs that target various biological pathways. The stereochemistry indicated by the (9R) designation suggests specific spatial arrangements of atoms, which can significantly influence the compound's interaction with biological targets. Additionally, this compound may exhibit properties such as analgesic, antimalarial, or antitumor activities, although specific biological effects would depend on further empirical studies. As with many alkaloids, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species.
Formula:C20H27N3O
InChI:InChI=1S/C20H27N3O/c1-3-13-12-23-9-7-14(13)10-19(23)20(21)16-6-8-22-18-5-4-15(24-2)11-17(16)18/h4-6,8,11,13-14,19-20H,3,7,9-10,12,21H2,1-2H3/t13-,14-,19+,20+/m0/s1
InChI key:InChIKey=HGVZOZLENNRYCV-AFHBHXEDSA-N
SMILES:[C@@H](N)(C=1C2=C(C=CC(OC)=C2)N=CC1)[C@@]3([N@@]4C[C@H](CC)[C@](C3)(CC4)[H])[H]
Synonyms:- (9R)-10,11-Dihydro-6′-methoxycinchonan-9-amine
- Cinchonan-9-amine, 10,11-dihydro-6′-methoxy-, (9R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
