CAS 52262-89-2
:ethyl 2-(6-chloro-9H-carbazol-2-yl)propanoate
Description:
Ethyl 2-(6-chloro-9H-carbazol-2-yl)propanoate, identified by its CAS number 52262-89-2, is an organic compound characterized by its ester functional group and a carbazole moiety. The presence of the chloro substituent at the 6-position of the carbazole ring contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound typically exhibits moderate solubility in organic solvents, reflecting the hydrophobic nature of the carbazole structure. Ethyl 2-(6-chloro-9H-carbazol-2-yl)propanoate may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Its structural features suggest that it may engage in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a versatile compound in synthetic organic chemistry. Additionally, the presence of the ethyl ester group may influence its pharmacokinetic properties, such as absorption and metabolism, in biological systems.
Formula:C17H16ClNO2
InChI:InChI=1/C17H16ClNO2/c1-3-21-17(20)10(2)11-4-6-13-14-9-12(18)5-7-15(14)19-16(13)8-11/h4-10,19H,3H2,1-2H3
SMILES:CCOC(=O)C(C)c1ccc2c3cc(ccc3[nH]c2c1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
