CAS 52263-23-7
:(4-oxocyclohexyl)acetic acid
Description:
(4-Oxocyclohexyl)acetic acid, with the CAS number 52263-23-7, is an organic compound characterized by its cyclohexane ring structure that features a ketone group at the 4-position and a carboxylic acid functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is soluble in polar solvents such as water and alcohols, which is indicative of the presence of the carboxylic acid group. The compound may exhibit moderate to high reactivity due to the presence of both the ketone and carboxylic acid functionalities, making it useful in various chemical reactions, including esterification and condensation reactions. Its unique structure allows it to participate in biological processes, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H12O3
InChI:InChI=1/C8H12O3/c9-7-3-1-6(2-4-7)5-8(10)11/h6H,1-5H2,(H,10,11)
SMILES:C1CC(=O)CCC1CC(=O)O
Synonyms:- Cyclohexaneacetic Acid, 4-Oxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(4-oxocyclohexyl)acetic acid
CAS:Formula:C8H12O3Purity:98%Color and Shape:SolidMolecular weight:156.1791(4-Oxocyclohexyl)acetic acid
CAS:Formula:C8H12O3Purity:97%Color and Shape:SolidMolecular weight:156.181(4-Oxocyclohexyl)acetic acid
CAS:(4-Oxocyclohexyl)acetic acid is an orthogonal molecule that has achiral properties. The carboxyl group (COOH) of the molecule is on the opposite side of the translationally symmetric O-C-C bond, which allows for conformational chains to form. This means that the molecule is asymmetrical and can be rotated in two ways. The carboxyl group also has a high affinity for hydrogen bonding.Formula:C8H12O3Purity:Min. 95%Molecular weight:156.18 g/mol



