CAS 522651-57-6

bromo-[(2,5-difluorophenyl)methyl]magnesium

Description:

Bromo-[(2,5-difluorophenyl)methyl]magnesium is an organomagnesium compound, specifically a Grignard reagent, characterized by its reactivity and utility in organic synthesis. This compound features a magnesium atom bonded to a bromo group and a 2,5-difluorophenylmethyl group, which contributes to its unique properties. Grignard reagents are known for their nucleophilic behavior, allowing them to react with electrophiles to form carbon-carbon bonds, making them valuable in the synthesis of various organic compounds. The presence of fluorine atoms in the phenyl ring can influence the electronic properties of the molecule, potentially enhancing its reactivity. Additionally, the compound is typically sensitive to moisture and air, requiring an anhydrous environment for storage and handling. Its applications may include the synthesis of complex organic molecules, pharmaceuticals, and agrochemicals. As with many organometallic compounds, safety precautions are essential due to their potential reactivity and toxicity.

Formula: C₇H₅BrF₂Mg

InChI: InChI=1/C7H5F2.BrH.Mg/c1-5-4-6(8)2-3-7(5)9;;/h2-4H,1H2;1H;/q;;+1/p-1/rC7H5BrF2Mg/c8-11-4-5-3-6(9)1-2-7(5)10/h1-3H,4H2

SMILES: C=C1C=C(C=CC1F)F.Br.[Mg]

2,5-Difluorobenzylmagnesium bromide 0.25M solution in diethyl ether

CAS: 522651-57-6

2,5-Difluorobenzylmagnesium bromide 0.25M solution in diethyl ether

Purity: ≥95%

Color and Shape: Liquid

Molecular weight: 231.32g/mol

Ref: 54-PC6651