CAS 5227-53-2: Azepan-2-carboxylic acid
Description:Azepan-2-carboxylic acid, also known as 2-piperidinecarboxylic acid, is a cyclic amino acid characterized by a seven-membered ring structure containing a carboxylic acid functional group. Its molecular formula typically includes carbon, hydrogen, and nitrogen atoms, reflecting its classification as an amino acid derivative. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Azepan-2-carboxylic acid is soluble in polar solvents, which is common for carboxylic acids, and its structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry and drug design. The compound may exhibit biological activity, influencing its applications in pharmaceuticals. Additionally, its cyclic nature can affect its conformational flexibility, impacting its reactivity and interactions with other molecules. Overall, Azepan-2-carboxylic acid is a versatile compound with potential applications in various fields, including organic synthesis and medicinal chemistry.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c9-7(10)6-4-2-1-3-5-8-6/h6,8H,1-5H2,(H,9,10)
InChI key:InChIKey=OPFURXRZISKMJV-UHFFFAOYSA-N
SMILES:O=C(O)C1NCCCCC1
- Synonyms:
- 1H-Azepine-2-carboxylic acid, hexahydro-
- Azepan-2-carboxylic acid
- Azepane-2-carboxylic acid
- Azepine-2-carboxylic acid, hexahydro-
- Azepine-2-carboxylicacid, hexahydro-
- Azocane-2-carboxylic acid
- Hexahydro-1H-azepine-2-carboxylic acid
- Hexahydroazepine-2-carboxylic acid
- Nsc 86359
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Azepane-2-carboxylic acid REF: IN-DA006VG2CAS: 5227-53-2 | 95% | To inquire | Mon 14 Apr 25 |
 | Azepane-2-carboxylic acid REF: 10-F214899CAS: 5227-53-2 | 95.0% | 53.00 €~785.00 € | Thu 17 Apr 25 |
 | Azepane-2-carboxylic acid REF: 3D-FAA22753CAS: 5227-53-2 | Min. 95% | - - - | Discontinued product |
Azepane-2-carboxylic acid
Ref: IN-DA006VG2
| 1g | 180.00 € | ||
| 5g | To inquire | ||
| 100mg | 72.00 € | ||
| 250mg | 125.00 € |
Ref: 10-F214899
| 1g | 191.00 € | ||
| 5g | 785.00 € | ||
| 100mg | 53.00 € | ||
| 250mg | 99.00 € |
Azepane-2-carboxylic acid
Ref: 3D-FAA22753
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 25mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
