CAS 5229-40-3

5-(Chloromethyl)-2-phenylpyridine

Description:

5-(Chloromethyl)-2-phenylpyridine, with the CAS number 5229-40-3, is an organic compound characterized by its pyridine ring structure substituted with a chloromethyl group and a phenyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the chloromethyl group, which can participate in nucleophilic substitution reactions. The phenyl group contributes to the compound's aromatic character, influencing its chemical behavior and potential applications. 5-(Chloromethyl)-2-phenylpyridine is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in various chemical reactions. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Proper handling and storage are essential, as with many chlorinated compounds, to mitigate any potential health hazards associated with exposure.

Formula: C₁₂H₁₀ClN

InChI: InChI=1/C12H10ClN/c13-8-10-6-7-12(14-9-10)11-4-2-1-3-5-11/h1-7,9H,8H2

SMILES: c1ccc(cc1)c1ccc(CCl)cn1

Synonyms:

• Pyridine, 5-(Chloromethyl)-2-Phenyl-
• 5-(CHLOROMETHYL)-2-PHENYLPYRIDINE

5-(Chloromethyl)-2-phenylpyridine

CAS: 5229-40-3

Formula: C₁₂H₁₀ClN

Color and Shape: Solid

Molecular weight: 203.6675

Ref: IN-DA006VDW

5-(Chloromethyl)-2-phenylpyridine

CAS: 5229-40-3

5-(Chloromethyl)-2-phenylpyridine

Formula: C₁₂H₁₀ClN

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 203.67g/mol

Ref: 54-OR14198

5-(Chloromethyl)-2-phenylpyridine

CAS: 5229-40-3

Formula: C₁₂H₁₀ClN

Purity: 95.0%

Molecular weight: 203.67

Ref: 10-F449023