CymitQuimica logo

CAS 523-40-0

:

2-[(2E,6E,10E,14E,18E,22E,26Z,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaen-1-yl]-3-methylnaphthalene-1,4-dione

Description:
The chemical substance known as 2-[(2E,6E,10E,14E,18E,22E,26Z,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaen-1-yl]-3-methylnaphthalene-1,4-dione, with the CAS number 523-40-0, is a complex organic compound characterized by its extensive polyene structure and multiple double bonds. This compound features a naphthoquinone moiety, which contributes to its potential reactivity and biological activity. The presence of long hydrocarbon chains indicates that it may exhibit hydrophobic properties, influencing its solubility and interaction with biological membranes. Additionally, the compound's structural complexity suggests potential applications in fields such as organic electronics, photochemistry, or as a precursor in synthetic organic chemistry. Its unique arrangement of double bonds may also impart specific optical properties, making it of interest for studies in photophysical behavior. Overall, this compound exemplifies the intricate relationship between molecular structure and functional properties in organic chemistry.
Formula:C61H88O2
InChI:InChI=1/C61H88O2/c1-46(2)24-15-25-47(3)26-16-27-48(4)28-17-29-49(5)30-18-31-50(6)32-19-33-51(7)34-20-35-52(8)36-21-37-53(9)38-22-39-54(10)40-23-41-55(11)44-45-57-56(12)60(62)58-42-13-14-43-59(58)61(57)63/h13-14,24,26,28,30,32,34,36,38,40,42-44H,15-23,25,27,29,31,33,35,37,39,41,45H2,1-12H3/b47-26+,48-28+,49-30-,50-32+,51-34+,52-36+,53-38+,54-40+,55-44+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.