CAS 523-66-0: Evolitrine

Description:Evolitrine, with the CAS number 523-66-0, is a chemical compound that belongs to the class of alkaloids, specifically derived from the plant species of the genus "Evolvulus." It is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Evolitrine exhibits a range of pharmacological properties, including potential anti-inflammatory and analgesic effects, making it of interest in medicinal chemistry. The compound is typically studied for its interactions with biological systems, and its effects on various cellular pathways. In terms of physical properties, evolitrine is usually a solid at room temperature, with specific solubility characteristics that depend on the solvent used. Its stability and reactivity can vary based on environmental conditions such as pH and temperature. As with many alkaloids, caution is advised when handling evolitrine due to its potential biological activity and effects on human health. Further research is ongoing to fully elucidate its mechanisms of action and potential therapeutic applications.

Formula:C₁₃H₁₁NO₃

InChI:InChI=1S/C13H11NO3/c1-15-8-3-4-9-11(7-8)14-13-10(5-6-17-13)12(9)16-2/h3-7H,1-2H3

InChI key:InChIKey=TWGHMXOYRUTQOL-UHFFFAOYSA-N

SMILES:N1=C2OC=CC2=C(OC)C=3C=CC(OC)=CC13

Synonyms:
7-Methoxydictamnine
Evolitrin
Evolitrine
Furo[2,3-B]Quinoline, 4,7-Dimethoxy-
4,7-Dimethoxyfuro[2,3-b]quinoline

Found 6 products.

Product data	Purity	Price range	Estimated delivery
EVOLITRINE REF: IN-DA00DV5XCAS: 523-66-0	98%	182.00 €~555.00 €	Wed 23 Apr 25
Evolitrine REF: 54-BUP01585CAS: 523-66-0	99%	1,000.00 €~1,270.00 €	Thu 24 Apr 25
Evolitrine REF: 7W-GY9774CAS: 523-66-0	- - -	To inquire	Thu 24 Apr 25
Evolitrine REF: BP-BP4230CAS: 523-66-0	95%~99%	180.00 €~287.00 €	Mon 28 Apr 25
Evolitrine REF: TM-T8207CAS: 523-66-0	99.03%	116.00 €~938.00 €	Wed 30 Apr 25
Evolitrine REF: 3D-AAA52366CAS: 523-66-0	Min. 95%	To inquire	Wed 04 Jun 25