CAS 523-73-9
:2-Heptyl-3,6-dihydroxy-5-(3-methyl-2-buten-1-yl)benzaldehyde
Description:
2-Heptyl-3,6-dihydroxy-5-(3-methyl-2-buten-1-yl)benzaldehyde, with CAS number 523-73-9, is an organic compound characterized by its complex structure, which includes a heptyl side chain and multiple functional groups. This compound features a benzaldehyde moiety, indicating the presence of an aldehyde functional group, along with two hydroxyl (-OH) groups positioned at the 3 and 6 positions of the aromatic ring. The presence of a 3-methyl-2-buten-1-yl group adds to its structural diversity, contributing to its potential reactivity and biological activity. Typically, compounds of this nature may exhibit properties such as solubility in organic solvents, varying degrees of polarity, and potential applications in fields like pharmaceuticals or agrochemicals. The hydroxyl groups can impart hydrogen bonding capabilities, influencing the compound's physical properties and interactions with other molecules. Overall, the unique combination of functional groups and the heptyl chain suggests that this compound may have interesting chemical behavior and potential utility in various applications.
Formula:C19H28O3
InChI:InChI=1S/C19H28O3/c1-4-5-6-7-8-9-16-17(13-20)19(22)15(12-18(16)21)11-10-14(2)3/h10,12-13,21-22H,4-9,11H2,1-3H3
InChI key:InChIKey=RGRXZGKXEJHPQQ-UHFFFAOYSA-N
SMILES:C(CCCCCC)C1=C(C=O)C(O)=C(CC=C(C)C)C=C1O
Synonyms:- 2-Heptyl-3,6-dihydroxy-5-(3-methyl-2-buten-1-yl)benzaldehyde
- 2-Heptyl-3,6-dihydroxy-5-(3-methyl-2-butenyl)benzaldehyde
- 6-Heptyl-3-(3-methyl-2-butenyl)gentisaldehyde
- Benzaldehyde, 2-heptyl-3,6-dihydroxy-5-(3-methyl-2-buten-1-yl)-
- Benzaldehyde, 2-heptyl-3,6-dihydroxy-5-(3-methyl-2-butenyl)-
- Flavoglaucin
- Flavoglaucine
- Gentisaldehyde, 6-heptyl-3-(3-methyl-2-butenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Flavoglaucin
CAS:Flavoglaucin inhibits PTP1B, IC50=13.4µM; binds to opioid/cannabinoid receptors; antitumor, anti-inflammatory, scavenges DPPH, IC50=11.3µM.Formula:C19H28O3Purity:98%Color and Shape:SolidMolecular weight:304.42Flavoglaucin
CAS:<p>Flavoglaucin is a chemical compound that belongs to the group of natural compounds. It has been found to have potential as a drug target for inflammation and allergic reactions, as it inhibits the function of PTP1B and LPS-stimulated RAW264.7 cells. Flavoglaucin also has anti-inflammatory properties, which may be due to its ability to inhibit the production of pro-inflammatory cytokines from LPS-stimulated RAW264.7 cells. The anti-inflammatory properties may also be related to its inhibition of tyrosinase activity in melanoma cells. Flavoglaucin is an endophytic fungus that can be found on plants such as garlic and onion.</p>Formula:C19H28O3Purity:Min. 95%Molecular weight:304.4 g/mol



