CAS 523-92-2
:Sequoyitol
Description:
Sequoyitol, with the CAS number 523-92-2, is a naturally occurring polyol, specifically a sugar alcohol derived from the hydrolysis of polysaccharides. It is characterized by its white crystalline appearance and is soluble in water, which makes it useful in various applications. Sequoyitol has a sweet taste, although it is less sweet than sucrose, and is often explored for its potential as a low-calorie sweetener. Its chemical structure features multiple hydroxyl (-OH) groups, contributing to its hygroscopic nature and ability to retain moisture. This property makes it valuable in food and pharmaceutical formulations, where it can enhance texture and stability. Additionally, sequoyitol has been studied for its potential health benefits, including its role in promoting gut health and its antioxidant properties. Overall, sequoyitol is a versatile compound with applications in food science, nutrition, and possibly in therapeutic contexts.
Formula:C7H14O6
InChI:InChI=1/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3+,4-,5-,6+,7+
InChI key:InChIKey=DSCFFEYYQKSRSV-GWJPIIGYNA-N
SMILES:O(C)[C@@H]1[C@@H](O)[C@H](O)[C@H](O)[C@H](O)[C@H]1O
Synonyms:- (1R,2S,4R,5S)-6-Methoxycyclohexane-1,2,3,4,5-pentol
- 1,2,3,4,5-cyclohexanepentol, 6-methoxy-, (1R,2S,4R,5S)-
- Inositol, 5-O-methyl-, myo-
- Sequoyit
- Sequoyitol
- myo-Inositol, 5-O-methyl-
- 5-O-Methyl-myo-inositol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Sequoyitol
CAS:Sequoyitol (5-O-Methyl-Myo-Inositol), a methyl derivative of inositol, is often used to treat diabetes.Formula:C7H14O6Purity:99.80% - ≥95%Color and Shape:SolidMolecular weight:194.185-O-Methyl-myo-inositol
CAS:Controlled ProductApplications 5-O-Methyl-myo-inositol or Sequoyitol is used in the treatment of diabetes, decreasing blood glucose, improving glucose intolerance and improving insulin signalling.
References Li, X. et al.: Can. J. Physiol. Pharmacol., 92, 405 (2014); Shen, H. et al.: Am. J. Physiol., 302, E932 (2012);Formula:C7H14O6Color and Shape:NeatMolecular weight:194.185-O-Methyl-myo-inositol
CAS:5-O-Methyl-myo-inositol is a specialized chemical compound, a derivative of the cyclic polyol inositol. It is primarily derived from natural plant sources where it occurs as part of various metabolic pathways. Its mode of action involves mimicking the structural properties of its parent compound, myo-inositol, allowing it to participate in cellular signaling processes. This structural similarity facilitates its involvement in various physiological mechanisms, including osmoregulation and cell membrane formation.Formula:C7H14O6Purity:Min. 95%Color and Shape:White PowderMolecular weight:194.18 g/mol5-O-Methyl-myo-inositol-d3
CAS:Controlled ProductFormula:C7D3H11O6Color and Shape:NeatMolecular weight:197.201Ref: IN-DA01E4NE
Discontinued product





