CAS 5230-02-4
:2-chloro-N-phenyl-5-(piperidin-1-ylsulfonyl)benzamide
Description:
2-Chloro-N-phenyl-5-(piperidin-1-ylsulfonyl)benzamide, with the CAS number 5230-02-4, is a chemical compound characterized by its complex structure, which includes a benzamide core substituted with a chlorine atom and a piperidine sulfonamide group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural features, which may interact with biological targets. The presence of the piperidine ring suggests possible pharmacological applications, as piperidine derivatives are often found in various therapeutic agents. Additionally, the sulfonyl group can enhance the compound's reactivity and stability. Its molecular structure allows for various interactions, making it a candidate for research in medicinal chemistry, particularly in the development of new drugs. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure levels.
Formula:C18H19ClN2O3S
InChI:InChI=1/C18H19ClN2O3S/c19-17-10-9-15(25(23,24)21-11-5-2-6-12-21)13-16(17)18(22)20-14-7-3-1-4-8-14/h1,3-4,7-10,13H,2,5-6,11-12H2,(H,20,22)
SMILES:c1ccc(cc1)N=C(c1cc(ccc1Cl)S(=O)(=O)N1CCCCC1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cloxacillin Thiol Carboxylate Benzathine
CAS:Controlled ProductFormula:C19H18ClN3O4S2·C16H20N2Color and Shape:NeatMolecular weight:692.29
