CAS 5230-02-4

2-chloro-N-phenyl-5-(piperidin-1-ylsulfonyl)benzamide

Description:

2-Chloro-N-phenyl-5-(piperidin-1-ylsulfonyl)benzamide, with the CAS number 5230-02-4, is a chemical compound characterized by its complex structure, which includes a benzamide core substituted with a chlorine atom and a piperidine sulfonamide group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural features, which may interact with biological targets. The presence of the piperidine ring suggests possible pharmacological applications, as piperidine derivatives are often found in various therapeutic agents. Additionally, the sulfonyl group can enhance the compound's reactivity and stability. Its molecular structure allows for various interactions, making it a candidate for research in medicinal chemistry, particularly in the development of new drugs. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure levels.

Formula: C₁₈H₁₉ClN₂O₃S

InChI: InChI=1/C18H19ClN2O3S/c19-17-10-9-15(25(23,24)21-11-5-2-6-12-21)13-16(17)18(22)20-14-7-3-1-4-8-14/h1,3-4,7-10,13H,2,5-6,11-12H2,(H,20,22)

SMILES: c1ccc(cc1)N=C(c1cc(ccc1Cl)S(=O)(=O)N1CCCCC1)O

Cloxacillin Thiol Carboxylate Benzathine

Controlled Product

CAS: 5230-02-4

Formula: C₁₉H₁₈ClN₃O₄S₂·C₁₆H₂₀N₂

Color and Shape: Neat

Molecular weight: 692.29

Ref: TR-C587480