CAS 52304-85-5

2,2,5,5-Tetramethyl-α-[(2-methylphenoxy)methyl]-1-pyrrolidineethanol

Description:

2,2,5,5-Tetramethyl-α-[(2-methylphenoxy)methyl]-1-pyrrolidineethanol, with CAS number 52304-85-5, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and multiple alkyl groups. This compound typically exhibits properties associated with both amines and alcohols due to the presence of a hydroxyl (-OH) group and a nitrogen atom in its structure. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. The presence of the bulky tetramethyl groups contributes to its steric hindrance, which can influence its reactivity and solubility in various solvents. Additionally, the aromatic 2-methylphenoxy group may impart specific interactions with biological systems, suggesting potential applications in pharmaceuticals or agrochemicals. As with many organic compounds, safety data should be consulted to understand its toxicity, handling, and environmental impact. Overall, this compound's unique structure may lead to interesting chemical behavior and applications in various fields.

Formula: C₁₈H₂₉NO₂

InChI: InChI=1S/C18H29NO2/c1-14-8-6-7-9-16(14)21-13-15(20)12-19-17(2,3)10-11-18(19,4)5/h6-9,15,20H,10-13H2,1-5H3

InChI key: InChIKey=ALJMIOMYHUNJQX-UHFFFAOYSA-N

SMILES: C(C(COC1=C(C)C=CC=C1)O)N2C(C)(C)CCC2(C)C

Synonyms:

• 1-(2,2,5,5-Tetramethyl-pyrrolidin-1-yl)-3-o-tolyloxy-propan-2-ol
• 2,2,5,5-Tetramethyl-α-[(2-methylphenoxy)methyl]-1-pyrrolidineethanol
• 1-Pyrrolidineethanol, 2,2,5,5-tetramethyl-α-[(2-methylphenoxy)methyl]-, (±)-
• 1-Pyrrolidineethanol, 2,2,5,5-tetramethyl-α-[(2-methylphenoxy)methyl]-
• Lotucaine

Lotucaine

CAS: 52304-85-5

Lotucaine is a local anesthetic.

Formula: C₁₈H₂₉NO₂

Color and Shape: Solid

Molecular weight: 291.43

Ref: TM-T32888