
CAS 52304-85-5
:2,2,5,5-Tetramethyl-α-[(2-methylphenoxy)methyl]-1-pyrrolidineethanol
Description:
2,2,5,5-Tetramethyl-α-[(2-methylphenoxy)methyl]-1-pyrrolidineethanol, with CAS number 52304-85-5, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and multiple alkyl groups. This compound typically exhibits properties associated with both amines and alcohols due to the presence of a hydroxyl (-OH) group and a nitrogen atom in its structure. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. The presence of the bulky tetramethyl groups contributes to its steric hindrance, which can influence its reactivity and solubility in various solvents. Additionally, the aromatic 2-methylphenoxy group may impart specific interactions with biological systems, suggesting potential applications in pharmaceuticals or agrochemicals. As with many organic compounds, safety data should be consulted to understand its toxicity, handling, and environmental impact. Overall, this compound's unique structure may lead to interesting chemical behavior and applications in various fields.
Formula:C18H29NO2
InChI:InChI=1S/C18H29NO2/c1-14-8-6-7-9-16(14)21-13-15(20)12-19-17(2,3)10-11-18(19,4)5/h6-9,15,20H,10-13H2,1-5H3
InChI key:InChIKey=ALJMIOMYHUNJQX-UHFFFAOYSA-N
SMILES:C(C(COC1=C(C)C=CC=C1)O)N2C(C)(C)CCC2(C)C
Synonyms:- 1-(2,2,5,5-Tetramethyl-pyrrolidin-1-yl)-3-o-tolyloxy-propan-2-ol
- 2,2,5,5-Tetramethyl-α-[(2-methylphenoxy)methyl]-1-pyrrolidineethanol
- 1-Pyrrolidineethanol, 2,2,5,5-tetramethyl-α-[(2-methylphenoxy)methyl]-, (±)-
- 1-Pyrrolidineethanol, 2,2,5,5-tetramethyl-α-[(2-methylphenoxy)methyl]-
- Lotucaine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lotucaine
CAS:<p>Lotucaine is a local anesthetic.</p>Formula:C18H29NO2Color and Shape:SolidMolecular weight:291.43
