CAS 5231-60-7
:Vindorosine
Description:
Vindorosine, with the CAS number 5231-60-7, is a naturally occurring alkaloid derived from the plant species of the Apocynaceae family, particularly from the genus Vinca. It is characterized by its complex structure, which includes a tetracyclic framework. Vindorosine exhibits notable pharmacological properties, primarily as an antitumor agent, and has been studied for its potential in cancer therapy. Its mechanism of action is thought to involve the inhibition of microtubule formation, thereby disrupting cell division and leading to apoptosis in cancer cells. Additionally, vindorosine may possess other biological activities, including anti-inflammatory and antimicrobial effects. The compound is typically isolated from plant sources and may require careful handling due to its bioactive nature. As with many alkaloids, its use in therapeutic applications is subject to ongoing research to fully understand its efficacy and safety profile.
Formula:C24H30N2O5
InChI:InChI=1S/C24H30N2O5/c1-5-22-11-8-13-26-14-12-23(18(22)26)16-9-6-7-10-17(16)25(3)19(23)24(29,21(28)30-4)20(22)31-15(2)27/h6-11,18-20,29H,5,12-14H2,1-4H3/t18-,19+,20+,22+,23+,24-/m0/s1
InChI key:InChIKey=SASWULSUPROHRT-MCIGMTSASA-N
SMILES:C(C)[C@@]12[C@]3([C@@]4([C@]([C@](C(OC)=O)(O)[C@@H]1OC(C)=O)(N(C)C=5C4=CC=CC5)[H])CCN3CC=C2)[H]
Synonyms:- (+)-Vindorosine
- 1H-Indolizino(8,1-cd)carbazole-5-carboxylic acid, 3a-ethyl-3a,4,5,5a,6,11,12,13a-octahydro-4,5-dihydroxy-6-methyl-, methyl ester, 4-acetate
- 1H-Indolizino[8,1-cd]carbazole, aspidospermidine-3-carboxylic acid deriv.
- Aspidospermidine-3-carboxylic acid, 4-(acetyloxy)-6,7-didehydro-3-hydroxy-1-methyl-, methyl ester, (2β,3β,4β,5α,12R,19α)-
- Aspidospermidine-3-carboxylic acid, 4-(acetyloxy)-6,7-didehydro-3-hydroxy-1-methyl-, methyl ester, (2β,3β,4β,5α,12β,19α)-
- Demethoxyvindoline
- NSC 94038
- Vindolidin
- Vindolidine
- Vindorosin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2β,5α,12β,19α)-4β-(Acetyloxy)-6,7-didehydro-3β-hydroxy-1-methylaspidospermidine-3-carboxylic acid methyl ester
CAS:Formula:C24H30N2O5Purity:97.5%Molecular weight:426.5054Vindorosine
CAS:Vindorosine relaxes blood vessels, likely by blocking L-type Ca(2+) channels.Formula:C24H30N2O5Purity:98%Color and Shape:SolidMolecular weight:426.51Vindorosine
CAS:Controlled ProductVindorosine is a chemotherapeutic agent, which is a vinca alkaloid derived from the plant Catharanthus roseus, commonly known as the Madagascar periwinkle. These alkaloids are known for their potent antineoplastic properties. Vindorosine exerts its effects by disrupting the polymerization of tubulin, a structural protein essential for microtubule formation. By inhibiting microtubule assembly, it effectively halts the cell cycle in metaphase, thereby preventing cancer cell division and inducing apoptosis.
Formula:C24H30N2O5Purity:Min. 95%Molecular weight:426.5 g/mol



