CAS 52315-92-1: L-lysine acetate

Description:L-lysine acetate is a salt formed from the amino acid L-lysine and acetic acid. It is characterized by its white crystalline appearance and is soluble in water, making it suitable for various applications in biochemistry and nutrition. L-lysine itself is an essential amino acid, meaning it must be obtained through diet, as the human body cannot synthesize it. The acetate form enhances its stability and solubility, facilitating its use in dietary supplements and pharmaceutical formulations. L-lysine acetate plays a role in protein synthesis, hormone production, and the absorption of calcium, contributing to overall health. It is often utilized in animal feed to promote growth and improve feed efficiency. Additionally, it may have applications in the treatment of certain medical conditions, such as herpes simplex virus infections, due to its potential antiviral properties. Safety data indicates that it is generally recognized as safe when used appropriately, although excessive intake should be avoided.

Formula:C₈H₁₈N₂O₄

InChI:InChI=1/C6H14N2O2.C2H4O2/c7-4-2-1-3-5(8)6(9)10;1-2(3)4/h5H,1-4,7-8H2,(H,9,10);1H3,(H,3,4)/t5-;/m1./s1