CAS 52320-66-8
:Pigment Yellow 75
Description:
Pigment Yellow 75, with the CAS number 52320-66-8, is an organic pigment primarily used in various applications such as coatings, plastics, and inks due to its vibrant yellow hue and excellent lightfastness. It is classified as a diarylide pigment, which is known for its high tinting strength and stability under UV light exposure. This pigment exhibits good chemical resistance and is non-toxic, making it suitable for use in consumer products. Its properties include high opacity, good dispersibility in different media, and compatibility with various resin systems. Additionally, Pigment Yellow 75 is often favored for its ability to maintain color integrity over time, even in harsh environmental conditions. The pigment is typically produced through a synthetic process, ensuring consistent quality and performance across different batches. Overall, Pigment Yellow 75 is valued for its aesthetic qualities and functional characteristics in industrial applications.
Formula:C18H17ClN4O5
InChI:InChI=1S/C18H17ClN4O5/c1-3-28-14-7-5-13(6-8-14)20-18(25)17(11(2)24)22-21-15-9-4-12(19)10-16(15)23(26)27/h4-10,17H,3H2,1-2H3,(H,20,25)
InChI key:InChIKey=ZCDDNAUHUZEVSJ-UHFFFAOYSA-N
SMILES:N(=NC(C(NC1=CC=C(OCC)C=C1)=O)C(C)=O)C2=C(N(=O)=O)C=C(Cl)C=C2
Synonyms:- 11770
- 2-[(4-chloro-2nitrophenyl)azo]-N-(4-ethoxphenyl)-3-oxo-Butanamide
- 2-[(E)-(4-chloro-2-nitrophenyl)diazenyl]-N-(4-ethoxyphenyl)-3-oxobutanamide
- 2-[2-(4-Chloro-2-nitrophenyl)diazenyl]-N-(4-ethoxyphenyl)-3-oxobutanamide
- Butanamide, 2-[(4-chloro-2-nitrophenyl)azo]-N-(4-ethoxyphenyl)-3-oxo-
- Butanamide, 2-[2-(4-chloro-2-nitrophenyl)diazenyl]-N-(4-ethoxyphenyl)-3-oxo-
- Hansa Yellow X-T
- Hansa Yellow XT
- P.Y.75
- Pigment Yellow 75
- p-Acetoacetophenetidide, 2-[(4-chloro-2-nitrophenyl)azo]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Pigment YellOw 75
CAS:Pigment YellOw 75 is a polymerization initiator that has a hydroxyl group and contains functional groups such as an amide, carboxylic acid, or alcohol. The monomers are vinyl acetate, ethylene glycol, and butanediol. Pigment YellOw 75 is used in the production of polyvinyl chloride (PVC). It acts as a radical polymerization initiator by abstracting hydrogen atoms from the vinyl acetate monomer to form radicals that initiate polymerization. This pigment also serves as a particle in radiation-curable coatings. Pigment YellOw 75 is highly reactive and can be used in reactive electrophotography.Purity:Min. 95%
