CymitQuimica logo

CAS 52322-22-2

:

2,2'-[ethane-1,2-diylbis(nitrosoimino)]dibutan-1-ol

Description:
2,2'-[ethane-1,2-diylbis(nitrosoimino)]dibutan-1-ol, with the CAS number 52322-22-2, is a chemical compound that features a complex structure characterized by the presence of nitrosoimino groups and a butanol moiety. This compound is likely to exhibit properties typical of nitroso compounds, such as potential reactivity due to the presence of the nitroso functional group, which can participate in various chemical reactions, including nucleophilic attacks and redox processes. The presence of the butanol component suggests that it may also possess alcohol-like characteristics, such as solubility in polar solvents and the ability to form hydrogen bonds. Additionally, the ethane-1,2-diyl linkage indicates that the molecule has a certain degree of flexibility, which may influence its reactivity and interactions with other substances. Overall, while specific physical and chemical properties such as boiling point, melting point, and solubility are not provided, the structural features suggest a compound with potential applications in organic synthesis or as an intermediate in chemical reactions.
Formula:C10H22N4O4
InChI:InChI=1/C10H22N4O4/c1-3-9(7-15)13(11-17)5-6-14(12-18)10(4-2)8-16/h9-10,15-16H,3-8H2,1-2H3
Synonyms:
  • Butanol, 2,2'-(ethylenebis(nitrosoimino))bis-
  • 2,2'-(Ethylenebis(nitrosoimino))bisbutanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.