CAS 52329-60-9
:Aminomebendazole
Description:
Aminomebendazole is a chemical compound that belongs to the class of benzimidazole derivatives, primarily known for its anthelmintic properties, which make it effective against parasitic infections. It is characterized by its ability to inhibit the polymerization of tubulin, thereby disrupting the cytoskeleton of the target organisms. This mechanism of action is similar to that of other benzimidazole compounds, leading to the paralysis and eventual death of the parasites. Aminomebendazole is typically administered in a solid form, and its solubility can vary depending on the pH of the environment. The compound is generally considered to have low toxicity in mammals, making it a suitable option for treating various helminthic infections. Additionally, it may exhibit some antifungal and antibacterial activities, although its primary use remains in the treatment of parasitic diseases. As with any pharmaceutical agent, proper dosage and administration are crucial to maximize efficacy while minimizing potential side effects.
Formula:C14H11N3O
InChI:InChI=1S/C14H11N3O/c15-14-16-11-7-6-10(8-12(11)17-14)13(18)9-4-2-1-3-5-9/h1-8H,(H3,15,16,17)
InChI key:InChIKey=GPMHHSJZGVOEFS-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=C2C(=CC1)N=C(N)N2)C3=CC=CC=C3
Synonyms:- (2-Amino-1H-benzimidazol-5-yl)phenylmethanone
- (2-Amino-1H-benzimidazol-6-yl)phenylmethanone
- (2-Amino-3H-benzimidazol-5-yl)-phenylmethanone
- (2-amino-1H-benzimidazol-5-yl)(phenyl)methanone
- 2-Amino-5-benzoyl-1H-benzimidazole
- 2-Amino-5-benzoylbenzimidazole
- Aminomebendazole
- G 1029
- R 18986
- methanone, (2-amino-1H-benzimidazol-5-yl)phenyl-
- methanone, (2-amino-1H-benzimidazol-6-yl)phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
(2-Amino-1H-benzimidazol-5-yl)phenylmethanone
CAS:Controlled ProductFormula:C14H11N3OColor and Shape:NeatMolecular weight:237.26Mebendazole-amine 100 µg/mL in Acetonitrile
CAS:Formula:C14H11N3OColor and Shape:Single SolutionMolecular weight:237.262-Amino-5(6)-benzoylbenzimidazole
CAS:Impurity Mebendazole EP Impurity A
Applications The minor urinary metabolite of Mebendazole (M200500) in man. Mebendazole impurity.
References Leban, J., et al.: Bioorg. Med. Chem. Lett., 17, 5858 (2007),Formula:C14H11N3OColor and Shape:NeatMolecular weight:237.262-Amino-5(6)-benzoylbenzimidazole
CAS:2-Amino-5(6)-benzoylbenzimidazole is an antifilarial and anthelmintic drug that belongs to the benzimidazole class. It is used for the treatment of filarial infections in humans, including lymphatic filariasis, which is caused by worms transmitted by mosquitoes. 2-Amino-5(6)-benzoylbenzimidazole has low bioavailability due to its poor water solubility. The drug can be administered orally or topically and is metabolized in the liver. The metabolites are excreted in urine as glucuronides and sulfates.
Formula:C14H11N3OPurity:Min. 95%Color and Shape:PowderMolecular weight:237.26 g/molMebendazole-amine
CAS:R-18986 is a biochemical substance.Formula:C14H11N3OColor and Shape:SolidMolecular weight:237.26







