CAS 5233-42-1
:4-[5-(3-nitrobenzoyl)-1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl]benzoic acid
Description:
4-[5-(3-nitrobenzoyl)-1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl]benzoic acid, with the CAS number 5233-42-1, is a complex organic compound characterized by its unique structural features, including a benzoic acid moiety and an isoindole derivative. This compound typically exhibits properties associated with both aromatic and heterocyclic systems, contributing to its potential applications in pharmaceuticals and organic synthesis. The presence of the nitro group suggests that it may exhibit electrophilic reactivity, while the dioxo functionality indicates potential for hydrogen bonding and coordination with metal ions. Its solubility characteristics can vary based on the solvent polarity, and it may display interesting optical properties due to its conjugated system. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this substance is of interest for its potential biological activity and utility in various chemical applications, warranting further investigation into its properties and reactivity.
Formula:C22H12N2O7
InChI:InChI=1/C22H12N2O7/c25-19(13-2-1-3-16(10-13)24(30)31)14-6-9-17-18(11-14)21(27)23(20(17)26)15-7-4-12(5-8-15)22(28)29/h1-11H,(H,28,29)
SMILES:c1cc(cc(c1)N(=O)=O)C(=O)c1ccc2c(c1)C(=O)N(c1ccc(cc1)C(=O)O)C2=O
Synonyms:- benzoic acid, 4-[1,3-dihydro-5-(3-nitrobenzoyl)-1,3-dioxo-2H-isoindol-2-yl]-
- 5,6-dichloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide
- 4-[5-(3-Nitrobenzoyl)-1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl]benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
5-Chloro Hydrochlorothiazide (5,6-dichloro-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine-7-sulfonamide 1,1-dioxide)
CAS:Sulfonamides, nesoiFormula:C7H7Cl2N3O4S2Color and Shape:White Off-White SolidMolecular weight:330.92555,6-Dichloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide
CAS:Formula:C7H7Cl2N3O4S2Purity:97%Color and Shape:SolidMolecular weight:332.18425-Chloro hydrochlorothiazide
CAS:5-Chloro hydrochlorothiazidePurity:97%Color and Shape:White To Off White SolidMolecular weight:332.18g/mol5-Chloro Hydrochlorothiazide
CAS:Formula:C7H7Cl2N3O4S2Color and Shape:White To Off-White SolidMolecular weight:332.175-chloro Hydrochlorothiazide
CAS:5-chloro Hydrochlorothiazide: a diuretic, antihypertensive derivative enhancing renal ion excretion.Formula:C7H7Cl2N3O4S2Color and Shape:SolidMolecular weight:332.185-Chloro Hydrochlorothiazide
CAS:Controlled ProductImpurity Hydrochlorothiazide 5-Chloro Impurity
Applications Hydrochlorothiazide derivative. Diuretic agent.
References Mayer, S.E., et al.: J. Pharmacol. Exp. Therap., 134, 18 (1961),Formula:C7H7Cl2N3O4S2Color and Shape:Off White SolidMolecular weight:332.18








