CAS 52333-42-3

7-Bromo-pyrido[2,3-b]pyrazine

Description:

7-Bromo-pyrido[2,3-b]pyrazine is a heterocyclic organic compound characterized by its fused pyridine and pyrazine rings, with a bromine substituent at the 7-position. This compound typically exhibits a pale yellow to brown solid appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF). Its molecular structure contributes to its potential applications in medicinal chemistry and material science, particularly in the development of pharmaceuticals and agrochemicals. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various chemical reactions, including cross-coupling reactions and nucleophilic substitutions. Additionally, the compound may exhibit interesting biological activities, which can be explored further in drug discovery research. As with many brominated compounds, safety precautions should be taken due to potential toxicity and environmental impact. Overall, 7-Bromo-pyrido[2,3-b]pyrazine is a valuable compound in synthetic organic chemistry with diverse applications.

Formula: C₇H₄BrN₃

InChI: InChI=1/C7H4BrN3/c8-5-3-6-7(11-4-5)10-2-1-9-6/h1-4H

SMILES: c1cnc2c(cc(cn2)Br)n1

Synonyms:

• Pyrido[2,3-b]pyrazine, 7-bromo-

7-Bromopyrido[2,3-b]pyrazine

CAS: 52333-42-3

Formula: C₇H₄BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 210.0308

Ref: IN-DA006UTM

7-Bromopyrido[2,3-b]pyrazine

CAS: 52333-42-3

7-Bromopyrido[2,3-b]pyrazine

Formula: C₇H₄BrN₃

Purity: 97%

Color and Shape: light brown crystalline solid

Molecular weight: 210.03g/mol

Ref: 54-OR6418

7-Bromopyrido[2,3-b]pyrazine

CAS: 52333-42-3

Formula: C₇H₄BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 210.034

Ref: 10-F046314