CymitQuimica logo

CAS 52333-55-8

:

2-(2-Chloro-6-fluorophenyl)oxazolo[4,5-b]pyridine

Description:
2-(2-Chloro-6-fluorophenyl)oxazolo[4,5-b]pyridine, with the CAS number 52333-55-8, is a heterocyclic compound characterized by its unique structural features, which include an oxazole ring fused to a pyridine system. This compound typically exhibits a molecular structure that incorporates a chloro and a fluorine substituent on the phenyl group, contributing to its chemical reactivity and potential biological activity. The presence of halogen atoms often enhances lipophilicity and can influence the compound's interaction with biological targets. In terms of physical properties, such compounds may exhibit moderate to high melting points and solubility in organic solvents, depending on their specific functional groups. Additionally, the oxazole and pyridine rings can participate in various chemical reactions, making this compound of interest in medicinal chemistry and material science. Its unique structure may also confer specific pharmacological properties, making it a candidate for further research in drug development or as a potential agrochemical.
Formula:C12H6ClFN2O
InChI:InChI=1S/C12H6ClFN2O/c13-7-3-1-4-8(14)10(7)12-16-11-9(17-12)5-2-6-15-11/h1-6H
InChI key:InChIKey=HFBIAULCRFAJGA-UHFFFAOYSA-N
SMILES:ClC1=C(C2=NC=3C(O2)=CC=CN3)C(F)=CC=C1
Synonyms:
  • Oxazolo[4,5-b]pyridine, 2-(2-chloro-6-fluorophenyl)-
  • 2-(2-Chloro-6-fluorophenyl)oxazolo[4,5-b]pyridine
  • 2-(2-Chloro-6-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.