CAS 52333-90-1

3-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline

Description:

3-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline, with the CAS number 52333-90-1, is a chemical compound characterized by its unique structure that combines an aniline moiety with an oxazole-pyridine ring system. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may include moderate to high stability under standard conditions. The presence of the oxazole and pyridine rings suggests potential biological activity, making it of interest in medicinal chemistry and drug development. It may also display specific solubility characteristics depending on the solvent used, and its reactivity can be influenced by the functional groups present in its structure. Additionally, this compound may participate in various chemical reactions, such as electrophilic substitutions or coupling reactions, due to the presence of the aniline group. Overall, 3-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline is a compound of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₁₂H₉N₃O

InChI: InChI=1/C12H9N3O/c13-9-4-1-3-8(7-9)12-15-11-10(16-12)5-2-6-14-11/h1-7H,13H2

SMILES: c1cc(cc(c1)N)c1nc2c(cccn2)o1

Synonyms:

• Benzenamine, 3-oxazolo[4,5-b]pyridin-2-yl-

3-oxazolo[4,5-b]pyridin-2-yl-aniline

CAS: 52333-90-1

Formula: C₁₂H₉N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 211.2194

Ref: IN-DA00DCTN

3-(Oxazolo[4,5-b]pyridin-2-yl)aniline

CAS: 52333-90-1

3-(Oxazolo[4,5-b]pyridin-2-yl)aniline

Purity: 95%

Molecular weight: 211.22g/mol

Ref: 54-OR1045369

(3-[1,3]oxazolo[4,5-b]pyridin-2-ylphenyl)amine

CAS: 52333-90-1

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 211.2239990234375

Ref: 10-F311204