CAS 52334-79-9

3-amino-6-methylpyridin-2-ol

Description:

3-Amino-6-methylpyridin-2-ol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an amino group (-NH2) at the 3-position and a hydroxyl group (-OH) at the 2-position, along with a methyl group (-CH3) at the 6-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the hydroxyl group. It can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it useful in organic synthesis and pharmaceutical applications. The compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its CAS number, 52334-79-9, allows for easy identification in chemical databases and literature. As with many nitrogen-containing heterocycles, it may also display interesting electronic properties, influencing its reactivity and interactions with other chemical species.

Formula: C₆H₈N₂O

InChI: InChI=1/C6H8N2O/c1-4-2-3-5(7)6(9)8-4/h2-3H,7H2,1H3,(H,8,9)

SMILES: Cc1ccc(c(n1)O)N

Synonyms:

• 2-Pyridinol, 3-Amino-6-Methyl-

3-Amino-6-methylpyridin-2-ol

CAS: 52334-79-9

Formula: C₆H₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 124.1405

Ref: IN-DA00DDXW

3-Amino-6-methylpyridin-2-ol

CAS: 52334-79-9

Versatile small molecule scaffold

Formula: C₆H₈N₂O

Purity: Min. 95%

Molecular weight: 124.14 g/mol

Ref: 3D-CCA33479