CAS 52340-48-4
:Undecylprodigiosin
Description:
Undecylprodigiosin is a natural red pigment belonging to the prodigiosin family, which are secondary metabolites produced by certain bacteria, notably from the genus *Serratia*. This compound is characterized by its long undecyl side chain, which contributes to its lipophilic nature, allowing it to integrate into biological membranes. Undecylprodigiosin exhibits antimicrobial properties, making it of interest for potential applications in pharmaceuticals and biotechnology. Its structure features a core prodigiosin backbone, which is known for its ability to form aggregates and exhibit red coloration. The compound is also noted for its potential role in bacterial signaling and biofilm formation. Additionally, it has been studied for its cytotoxic effects on various cancer cell lines, indicating possible therapeutic applications. However, further research is needed to fully understand its mechanisms of action and potential uses in medicine. As with many natural products, the extraction and purification processes can be complex, and the compound's stability may vary under different environmental conditions.
Formula:C25H35N3O
InChI:InChI=1S/C25H35N3O/c1-3-4-5-6-7-8-9-10-11-13-20-15-16-21(27-20)18-24-25(29-2)19-23(28-24)22-14-12-17-26-22/h12,14-19,26-27H,3-11,13H2,1-2H3/b24-18-
InChI key:InChIKey=HIYSWASSDOXZLC-MOHJPFBDSA-N
SMILES:C(=C\1/C(OC)=CC(=N1)C2=CC=CN2)\C=3NC(CCCCCCCCCCC)=CC3
Synonyms:- Undecylprodiginine
- 1H-Pyrrole, 2-[(Z)-[3-methoxy-5-(1H-pyrrol-2-yl)-2H-pyrrol-2-ylidene]methyl]-5-undecyl-
- Undecylprodiginin
- 2-[(Z)-[3-Methoxy-5-(1H-pyrrol-2-yl)-2H-pyrrol-2-ylidene]methyl]-5-undecyl-1H-pyrrole
- Undecylprodigiosin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Undecylprodigiosin
CAS:Controlled ProductFormula:C25H35N3OColor and Shape:NeatMolecular weight:393.565Undecylprodigiosin
CAS:<p>Undecylprodigiosin is a classical cytotoxic immunosuppressant, suppressing immune functions. It also inhibits DNA synthesis.</p>Formula:C25H35N3OColor and Shape:SolidMolecular weight:393.56


