CAS 52345-47-8
:2-[(4-Methylphenyl)sulfonyl]acetamide
Description:
2-[(4-Methylphenyl)sulfonyl]acetamide, with the CAS number 52345-47-8, is an organic compound characterized by the presence of both an acetamide and a sulfonyl group. This compound features a sulfonyl group (-SO2-) attached to a 4-methylphenyl group, which is further linked to an acetamide moiety. It typically appears as a solid at room temperature and is soluble in polar organic solvents. The presence of the sulfonyl group contributes to its potential as a versatile intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its structure allows for various functionalizations, which can enhance its reactivity and utility in chemical reactions. As with many sulfonamides, it may also display properties such as antimicrobial activity, although specific biological effects would depend on further empirical studies. Proper handling and safety measures should be observed due to potential toxicity associated with sulfonamide derivatives.
Formula:C9H11NO3S
InChI:InChI=1S/C9H11NO3S/c1-7-2-4-8(5-3-7)14(12,13)6-9(10)11/h2-5H,6H2,1H3,(H2,10,11)
InChI key:InChIKey=ACGVKXZPAUDGMM-UHFFFAOYSA-N
SMILES:S(CC(N)=O)(=O)(=O)C1=CC=C(C)C=C1
Synonyms:- 2-((4-Methylphenyl)sulfonyl)ethanamide
- 2-(4-Methylbenzenesulfonyl)acetamide
- 2-(p-Toluenesulfonyl)acetamide
- 2-[(4-Methylphenyl)Sulfonyl]Acetamide
- Acetamide, 2-((4-methylphenyl)sulfonyl)-
- Acetamide, 2-(p-tolylsulfonyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-((4-Methylphenyl)sulfonyl)ethanamide
CAS:2-((4-Methylphenyl)sulfonyl)ethanamide is an amide that has been shown to have antibacterial activity. It binds to the DNA of bacteria, inhibiting its replication and transcription. This drug also inhibits the growth of influenza virus in cell culture. 2-((4-Methylphenyl)sulfonyl)ethanamide is a sensor for chloride ions, which may be used as treatments for bacterial infections. This drug is also able to inhibit the replication of bacteria that are resistant to other antibiotics, such as penicillin. The unsaturated alkyl group on this molecule allows it to be activated by radiation treatment, which may be useful in the treatment of cancer cells or viral infections.Formula:C9H11NO3SPurity:Min. 95%Color and Shape:PowderMolecular weight:213.25 g/mol

