CymitQuimica logo

CAS 5235-10-9

:

1H-indazole-3-carboxaldehyde

Description:
1H-Indazole-3-carboxaldehyde is an organic compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. This compound features a carboxaldehyde functional group (-CHO) at the 3-position of the indazole ring, contributing to its reactivity and potential applications in organic synthesis. It typically appears as a crystalline solid and is soluble in polar organic solvents. The presence of the aldehyde group makes it susceptible to oxidation and nucleophilic attack, allowing it to participate in various chemical reactions, such as condensation and addition reactions. 1H-Indazole-3-carboxaldehyde is of interest in medicinal chemistry and material science due to its potential biological activities and utility as a building block in the synthesis of more complex molecules. Its CAS number, 5235-10-9, is a unique identifier that facilitates the tracking and study of this compound in scientific literature and databases. Overall, this compound exemplifies the diverse chemistry associated with heterocyclic compounds.
Formula:C8H6N2O
InChI:InChI=1/C8H6N2O/c11-5-8-6-3-1-2-4-7(6)9-10-8/h1-5H,(H,9,10)
InChI key:VXOSGHMXAYBBBB-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c(C=O)n[nH]2
Synonyms:
  • 3-Indazolecarbaldehyde
  • 1H-indazole-3-carbaldehyde
  • 2H-indazole-3-carbaldehyde
Found 5 products.