CAS 52351-75-4
:6-methoxy-1H-indole-2,3-dione
Description:
6-Methoxy-1H-indole-2,3-dione, also known as 6-methoxyindole-2,3-dione, is an organic compound characterized by its indole structure, which features a methoxy group at the 6-position and a diketone functionality at the 2 and 3 positions. This compound typically appears as a solid and is soluble in organic solvents, reflecting its aromatic nature. The presence of the methoxy group enhances its electron-donating properties, which can influence its reactivity and interactions with biological systems. 6-Methoxy-1H-indole-2,3-dione is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antioxidant and anti-inflammatory properties. Its structure allows for various chemical modifications, making it a versatile scaffold for drug development. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, this compound represents a significant interest in research due to its unique chemical properties and potential therapeutic applications.
Formula:C8H7NO3
InChI:InChI=1/C9H7NO3/c1-13-5-2-3-6-7(4-5)10-9(12)8(6)11/h2-4H,1H3,(H,10,11,12)
SMILES:COc1ccc2c(c1)NC(=O)C2=O
Synonyms:- 1H-Indole-2,3-dione, 6-methoxy-
- 6-Methoxy-1H-indol-2,3-dion
- 6-Methoxyindoline-2,3-Dione
- 6-Methoxy-2,3-Dioxyindole
- 6-Methoxyisatin
- 6-Methoxy-1H-indole-2,3-dione
- 6-Methoxyindolin-2,3-dione, 6-Methoxy-1H-indole-2,3-dione
- 6-methoxyindigo
- 6-HYDROXY-1H-INDOLE-2,3-DIONE
- 6-Methoxyisatin 6-Methoxy-indole-2,3-dione
- 3-DIOXYINDOLE
- 6-Methoxy-1H-indoline-2,3-dione
- 4-Methoxy-3-iodobenzoylchloride
- 6-Methoxy-2,3-indolinedione
- 6-Methoxyindole-2,3-dione
- 6-METHOXY-2
- 1H-indole-2,3,6-triol
- 6-Methoxy-1H-indol-2,3-dione
- 6-methoxy-2,3-dihydro-1H-indole-2,3-dione
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Methoxyisatin
CAS:Formula:C9H7NO3Purity:>97.0%(T)(HPLC)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:177.166-Methoxy-2,3-Dioxyindole
CAS:Formula:C9H7NO3Purity:98%Color and Shape:SolidMolecular weight:177.15686-Methoxyisatin
CAS:6-MethoxyisatinFormula:C9H7NO3Purity:≥95%Color and Shape: yellow powderMolecular weight:177.16g/mol6-Methoxyindoline-2,3-dione
CAS:6-Methoxyindoline-2,3-dione is an indole alkaloid that has been isolated from the leaves of plants in the genus Apiaceae. It is synthesized by a reaction system that involves the oxidation of 6-methoxyindole to the corresponding oxindole and subsequent reduction to the desired product. The cytotoxicity of 6-methoxyindoline-2,3-dione has been demonstrated using a fluorescent assay with cancer cells. The compound binds to and activates cb2 receptors, which are expressed on immune cells and have been shown to be involved in inflammatory processes.Formula:C9H7NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:177.16 g/mol




