CAS 52351-75-4: 6-methoxy-1H-indole-2,3-dione

Description:6-Methoxy-1H-indole-2,3-dione, also known as 6-methoxyindole-2,3-dione, is an organic compound characterized by its indole structure, which features a methoxy group at the 6-position and a diketone functionality at the 2 and 3 positions. This compound typically appears as a solid and is soluble in organic solvents, reflecting its aromatic nature. The presence of the methoxy group enhances its electron-donating properties, which can influence its reactivity and interactions with biological systems. 6-Methoxy-1H-indole-2,3-dione is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antioxidant and anti-inflammatory properties. Its structure allows for various chemical modifications, making it a versatile scaffold for drug development. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, this compound represents a significant interest in research due to its unique chemical properties and potential therapeutic applications.

Formula:C₉H₇NO₃

InChI:InChI=1/C9H7NO3/c1-13-5-2-3-6-7(4-5)10-9(12)8(6)11/h2-4H,1H3,(H,10,11,12)

Synonyms:
1H-Indole-2,3-dione, 6-methoxy-
6-Methoxy-1H-indol-2,3-dion
6-Methoxyindoline-2,3-Dione
6-Methoxy-2,3-Dioxyindole
6-Methoxyisatin
6-Methoxy-1H-indole-2,3-dione

Found 5 products.

Product data	Purity	Price range	Estimated delivery
6-Methoxyisatin REF: 3B-M2856CAS: 52351-75-4	>97.0%(T)(HPLC)	60.00 €~179.00 €	Tue 22 Apr 25
6-Methoxy-2,3-Dioxyindole REF: IN-DA0034D8CAS: 52351-75-4	98%	21.00 €~582.00 €	Tue 29 Apr 25
6-Methoxyisatin REF: 10-F038240CAS: 52351-75-4	98.0%	16.00 €~411.00 €	Fri 02 May 25
6-Methoxyisatin REF: 54-OR52220CAS: 52351-75-4	98% (Typical Value in Batch COA)	50.00 €~208.00 €	Tue 06 May 25
6-Methoxyindoline-2,3-dione REF: 3D-FM140675CAS: 52351-75-4	Min. 95%	143.00 €~1,576.00 €	Mon 12 May 25