CAS 52356-01-1
:2-Carboxyphenylhydrazine hydrochloride
Description:
2-Carboxyphenylhydrazine hydrochloride, with the CAS number 52356-01-1, is a chemical compound that belongs to the class of hydrazines. It is characterized by the presence of a carboxylic acid group and a hydrazine functional group, which contribute to its reactivity and potential applications in organic synthesis. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. Its molecular structure allows it to participate in various chemical reactions, including those involving diazotization and condensation, making it useful in the synthesis of azo dyes and other organic compounds. Additionally, 2-Carboxyphenylhydrazine hydrochloride may exhibit biological activity, which has led to investigations into its potential applications in pharmaceuticals and agrochemicals. As with many hydrazine derivatives, it is important to handle this compound with care due to its potential toxicity and reactivity. Proper safety measures should be observed when working with this substance in a laboratory setting.
Formula:C7H8N2O2·ClH
InChI:InChI=1S/C7H8N2O2.ClH/c8-9-6-4-2-1-3-5(6)7(10)11;/h1-4,9H,8H2,(H,10,11);1H
InChI key:InChIKey=ZGNNOFKURIXXRF-UHFFFAOYSA-N
SMILES:N(N)C1=C(C(O)=O)C=CC=C1.Cl
Synonyms:- 2-Carboxyphenylhydrazine hydrochloride
- 2-Hydrazinobenzoate
- 2-Hydrazinobenzoic acid hydrochloride (1:1)
- 2-Hydrazinobenzoic acid monohydrochloride
- 2-Hydrazinylbenzoic Acid Hydrochloride (1:1)
- 2-Hydrazinylbenzoic acid hydrochloride
- Benzoic Acid, 2-Hydrazino-, Monohydrochloride
- Benzoic Acid, 2-Hydrazinyl-, Hydrochloride (1:1)
- Benzoic acid, 2-hydrazino-, hydrochloride
- o-Hydrazinobenzoic acid hydrochloride
- o-Hydrazinobenzoic acid monohydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Hydrazinobenzoic acid
CAS:Formula:C7H9ClN2O2Purity:95%Color and Shape:SolidMolecular weight:188.61162-Hydrazinobenzoic acid hydrochloride
CAS:2-Hydrazinobenzoic acid hydrochloridePurity:98%Molecular weight:188.61g/mol2-Hydrazinobenzoic acid hydrochloride
CAS:Formula:C7H9ClN2O2Purity:95%Color and Shape:SolidMolecular weight:188.612-Hydrazinobenzoic acid hydrochloride - technical grade
CAS:2-Hydrazinobenzoic acid hydrochloride is a synthetic compound that can be used as a ligand or substrate for the polymerase. It has been shown to interact with the NS5B polymerase, which is involved in viral replication and drug resistance. 2-Hydrazinobenzoic acid hydrochloride also produces reduction products and luminescence when combined with chloride. The luminescence is thought to be due to an interaction with the nucleophilic carbonyl group of 2-hydrazinobenzoic acid hydrochloride and a nucleophilic attack on the carbonyl oxygen atom by chloride ions. This reaction produces blue light at around 470 nm.Formula:C7H8N2O2·xHClPurity:(%) Min. 60%Color and Shape:PowderMolecular weight:188.61 g/mol



