CAS 52378-40-2
:Methyl N-cyano-N′-[2-[[(4-methyl-1H-imidazol-5-yl)methyl]thio]ethyl]carbamimidothioate
Description:
Methyl N-cyano-N′-[2-[[(4-methyl-1H-imidazol-5-yl)methyl]thio]ethyl]carbamimidothioate, with the CAS number 52378-40-2, is a chemical compound characterized by its complex structure, which includes a cyano group, an imidazole ring, and a thioether linkage. This compound typically exhibits properties associated with thioamides and can participate in various chemical reactions due to the presence of functional groups such as the cyano and thio groups. It may display moderate to high solubility in polar organic solvents, depending on the specific conditions. The imidazole moiety suggests potential biological activity, as imidazole derivatives are often found in pharmaceuticals and agrochemicals. Additionally, the presence of the carbamimidothioate group indicates potential applications in biological systems, possibly as a precursor for other chemical transformations or as a bioactive agent. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological applications.
Formula:C10H15N5S2
InChI:InChI=1S/C10H15N5S2/c1-8-9(15-7-14-8)5-17-4-3-12-10(16-2)13-6-11/h7H,3-5H2,1-2H3,(H,12,13)(H,14,15)
InChI key:InChIKey=WSUNDBVVUCLXTG-UHFFFAOYSA-N
SMILES:C(SCCN=C(NC#N)SC)C1=C(C)N=CN1
Synonyms:- Carbamimidothioic acid, N-cyano-N′-[2-[[(4-methyl-1H-imidazol-5-yl)methyl]thio]ethyl]-, methyl ester
- Carbamimidothioic acid, N-cyano-N′-[2-[[(5-methyl-1H-imidazol-4-yl)methyl]thio]ethyl]-, methyl ester
- Methyl N-cyano-N′-[2-[[(4-methyl-1H-imidazol-5-yl)methyl]thio]ethyl]carbamimidothioate
- N-Cyano-N'-[2-((4-methyl-5-imidazoly)methylthio)ethyl-S-methylisothiourea
- N-Cyano-N'-[2-(4-methyl-5-imidazolyl)methylthio]etheyl-S-methylisothiourea
- N-Cyano-N′-[2-[(4-methyl-5-imidazolyl)methylthio]ethyl]-S-methylisothiourea
- N-Cyano-N′-[2-[[(5-methyl-4-imidazolyl)methyl]thio]ethyl]-S-methylisothiourea
- methyl N-cyano-N'-(2-{[(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl}ethyl)carbamimidothioate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Cimetidine EP Impurity A
CAS:Formula:C10H15N5S2Color and Shape:White To Off-White SolidMolecular weight:269.39N-Cyano-N′-[2-[[(4-methyl-1H-imidazol-5-yl)methyl]thio]ethyl]-,Carbamimidothioic acid methyl ester (Cimetidine Impurity)
CAS:N-Cyano-N′-[2-[[(4-methyl-1H-imidazol-5-yl)methyl]thio]ethyl]-,Carbamimidothioic acid methyl ester (Cimetidine Impurity)Purity:98%Cimetidine EP Impurity A
CAS:Controlled ProductFormula:C10H15N5S2Color and Shape:NeatMolecular weight:269.39S-Methyl-N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylthio]ethyl]isothiourea
CAS:Methylisothiourea is a label that can be used to identify cells in vivo. It is a fluorescent molecule that is activated by the presence of cytokines, such as IL-1β and TNF-α. Methylisothiourea has been used to evaluate corneal epithelial cells for their response to injury. The effect of Methylisothiourea on the tissue was assessed by histology and evaluated by the presence of cytokine concordance with the fluorescence intensity. Reconstitution experiments were conducted in vitro using human tissues. It was found that Methylisothiourea was not toxic at concentrations up to 500 μM and that it did not interfere with DNA synthesis or cell division at concentrations up to 10 mM.
Formula:C10H15N5S2Purity:Min. 95%Color and Shape:White PowderMolecular weight:269.39 g/molN-Cyano-N’-[2-[(4-methyl-5-imidazolyl)methylthio]ethyl]-S-methylisothiourea
CAS:Controlled ProductFormula:C10H15N5S2Color and Shape:NeatMolecular weight:269.39





